
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53688-18-9 |
| Catalog No. | 2A-9044039 |
| Chinese Name | 2-氯-5'-氟苯乙酮 |
| Synonyms | 2-Chloro-1-(3-fluorophenyl)ethanone; 3'-FLUOROPHENACYL CHLORIDE; m-Fluorophenacyl Chloride; 2-chloro-1-(3-fluoro-phenyl)-ethanone |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.59 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 240.3±15.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2914700090 |
| PubChem ID | 38383132 |
| SMILES | O=C(CCl)c1cccc(F)c1 |
| InChI | InChI=1S/C8H6ClFO/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2 |
| InChI Key | XGRNMEBMWPBPRT-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dezocine | 53648-55-8 | 2A-9044032 |
| 5,5'-Dichloro-11-diphenylamino-3,3'-diethyl-10,12-ethylenethiatricarbocyanine perchlorate | 53655-17-7 | 2A-9044033 |
| 4-Ethylphenylhydrazine hydrochloride | 53661-18-0 | 2A-9044034 |
| 2-Bromo-3-methylbenzoic acid | 53663-39-1 | 2A-9044037 |
| N-Chlorobetainyl chloride | 53684-57-4 | 2A-9044038 |
| Polyquaternium-22 | 53694-17-0 | 2A-9044040 |
| Armillarisin A | 53696-74-5 | 2A-9044041 |
| Leuprorelin | 53714-56-0 | 2A-9044043 |
| Ethyl viologen dibromide | 53721-12-3 | 2A-9044047 |
| 2-Aminobutanamide | 53726-14-0 | 2A-9044048 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA