
CAS Number53661-18-0
SynonymsHydrazine, (4-ethylphenyl)-, hydrochloride (1:1); MFCD02068297; (4-Ethylphenyl)hydrazine hydrochloride (1:1); (4-Ethylphenyl)hydrazine hydrochloride; (4-ethylphenyl)hydrazine,hydrochloride
Molecular FormulaC8H13ClN2
Molecular Weight172.66
Purity98.00%
Boiling Point257.6ºC at 760 mmHg
Melting Point67-71ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53661-18-0 |
| Catalog No. | 2A-9044034 |
| Chinese Name | 4-乙基苯肼盐酸盐 |
| Synonyms | Hydrazine, (4-ethylphenyl)-, hydrochloride (1:1); MFCD02068297; (4-Ethylphenyl)hydrazine hydrochloride (1:1); (4-Ethylphenyl)hydrazine hydrochloride; (4-ethylphenyl)hydrazine,hydrochloride |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 |
| Purity | 98.00 |
| Boiling Point | 257.6ºC at 760 mmHg |
| Melting Point | 67-71ºC |
| Appearance | white powder |
| Storage Condition | room temperature |
| HTC | 2928000090 |
| PubChem ID | 3188996 |
| SMILES | CCc1ccc(NN)cc1.Cl |
| InChI | InChI=1S/C8H12N2.ClH/c1-2-7-3-5-8(10-9)6-4-7;/h3-6,10H,2,9H2,1H3;1H |
| InChI Key | YGFUKCJADFMHGW-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Polyquaternium-11 | 53633-54-8 | 2A-9044028 |
| 4-Methylumbelliferyl beta-D-N,N'-diacetylchitobioside | 53643-12-2 | 2A-9044030 |
| Vindesine | 53643-48-4 | 2A-9044031 |
| Dezocine | 53648-55-8 | 2A-9044032 |
| 5,5'-Dichloro-11-diphenylamino-3,3'-diethyl-10,12-ethylenethiatricarbocyanine perchlorate | 53655-17-7 | 2A-9044033 |
| 2-Bromo-3-methylbenzoic acid | 53663-39-1 | 2A-9044037 |
| N-Chlorobetainyl chloride | 53684-57-4 | 2A-9044038 |
| 2-Chloro-5'-fluoroacetophenone | 53688-18-9 | 2A-9044039 |
| Polyquaternium-22 | 53694-17-0 | 2A-9044040 |
| Armillarisin A | 53696-74-5 | 2A-9044041 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA