
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53348-05-3 |
| Catalog No. | 2A-9043970 |
| Chinese Name | 3,6-二溴菲醌 |
| Synonyms | 3,6-dibromophenanthrene-9,10-dione; 3,6-Dibromo-9,10-phenanthrenedione |
| Molecular Formula | C14H6Br2O2 |
| Molecular Weight | 366.01 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 501.0±43.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2914700090 |
| PubChem ID | 124085 |
| SMILES | O=C1C(=O)c2ccc(Br)cc2-c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H6Br2O2/c15-7-1-3-9-11(5-7)12-6-8(16)2-4-10(12)14(18)13(9)17/h1-6H |
| InChI Key | WPEJBJRFPBMVGJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(1H-Imidazol-2-yl)methanamine | 53332-80-2 | 2A-9043964 |
| 3,3'-Dipropylthiacarbocyanine iodide | 53336-12-2 | 2A-9043965 |
| 4-Mercaptobenzyl alcohol | 53339-53-0 | 2A-9043966 |
| Nile Blue A perchlorate | 53340-16-2 | 2A-9043967 |
| 9,10-Diaminophenanthrene | 53348-04-2 | 2A-9043969 |
| 3',4',5',5,7-Pentamethoxyflavone | 53350-26-8 | 2A-9043971 |
| Diethyl 2-(4-(benzyloxy)benzylidene)malonate | 53361-40-3 | 2A-9043972 |
| Sodium O,O-diisobutyl dithiophosphate | 53378-51-1 | 2A-9043976 |
| cis-3-Hexenyl 2-methylbutanoate | 53398-85-9 | 2A-9043977 |
| Ethyl 2-methyl-4-pentenoate | 53399-81-8 | 2A-9043978 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA