
CAS Number53295-44-6
Synonyms5,6-Dimethoxy-1-oxo-indan-2-carbonsaeure-aethylester; 2-ethoxycarbonyl-5,6-dimethoxyindan-1-one; ETHYL 2,3-DIHYDRO-5,6-DIMETHOXY-1-OXO-1H-INDENE-2-CARBOXYLATE; Q113; ethyl 5,6-dimethoxy-1-oxo-2,3-dihydro-1H-indene-2-carboxylate; ethyl 5,6-dimethoxy-1-indanone-2-carboxylate; 5,6-dimethoxy-1-oxo-indan-2-carboxylic acid ethyl ester
Molecular FormulaC12H12O3
Molecular Weight204.23
Purity98.00%
Density1.217 g/cm3
Boiling Point404.307ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53295-44-6 |
| Catalog No. | 2A-9043950 |
| Chinese Name | 5,6-二甲氧基-1-茚酮-2-羧酸乙酯 |
| Synonyms | 5,6-Dimethoxy-1-oxo-indan-2-carbonsaeure-aethylester; 2-ethoxycarbonyl-5,6-dimethoxyindan-1-one; ETHYL 2,3-DIHYDRO-5,6-DIMETHOXY-1-OXO-1H-INDENE-2-CARBOXYLATE; Q113; ethyl 5,6-dimethoxy-1-oxo-2,3-dihydro-1H-indene-2-carboxylate; ethyl 5,6-dimethoxy-1-indanone-2-carboxylate; 5,6-dimethoxy-1-oxo-indan-2-carboxylic acid ethyl ester |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| Purity | 98.00 |
| Density | 1.217 g/cm3 |
| Boiling Point | 404.307ºC at 760 mmHg |
| HTC | 2918990090 |
| PubChem ID | 16616434 |
| MDL Number | MFCD11976256 |
| SMILES | CCOC(=O)C1Cc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C14H16O5/c1-4-19-14(16)10-5-8-6-11(17-2)12(18-3)7-9(8)13(10)15/h6-7,10H,4-5H2,1-3H3 |
| InChI Key | MHNGDAMDDQGRJJ-UHFFFAOYSA-N |
| MSDS | msds/43950_1_53295_44_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,2-Dimethyltetrahydro-2H-pyran-4-carboxylic acid | 52916-16-2 | 2A-9043873 |
| 4'-Methoxybiphenyl-4-carbaldehyde | 52988-34-8 | 2A-9043880 |
| Methyl 2-(bromomethyl)-3-furoate | 53020-08-9 | 2A-9043886 |
| 3-Methoxy-2-nitrobenzaldehyde | 53055-05-3 | 2A-9043890 |
| (1R-cis)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid | 53179-78-5 | 2A-9043917 |
| 4-Trifluoromethyldiphenyl sulfide | 53451-90-4 | 2A-9043991 |
| Hexapotassium dihydrogen [hexane-1,6-diylbis[nitrilobis(methylene)]]tetrakisphosphonate | 53473-28-2 | 2A-9043997 |
| 3-[4-(Trifluoromethyl)phenyl]propanoic acid | 53473-36-2 | 2A-9043998 |
| 3-Trifluoromethylthiobenzamide | 53515-17-6 | 2A-9044006 |
| 1-(2-Trifluoromethylphenyl)-2-nitroethylene | 53960-62-6 | 2A-9044091 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA