
CAS Number53055-05-3
Synonyms3-methoxy 2-nitrobenzaldehyde; EINECS 258-332-9; 2-nitro-3-methoxybenzaldehyde; 3-Methoxy-2-nitro-benzaldehyd; 3-Methoxy-2-nitrobenzaldehyde; MFCD00007135
Molecular FormulaCH3OC6H3(NO2)CHO
Molecular Weight181.15
Purity≥97%
Density1.3±0.1 g/cm3
Boiling Point344.2±27.0 °C at 760 mmHg
Melting Point97-101 °C (lit.)
Appearancesolid
EINECS258-332-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53055-05-3 |
| Catalog No. | 2A-9043890 |
| Chinese Name | 3-甲氧基-2-硝基苯甲醛 |
| Synonyms | 3-methoxy 2-nitrobenzaldehyde; EINECS 258-332-9; 2-nitro-3-methoxybenzaldehyde; 3-Methoxy-2-nitro-benzaldehyd; 3-Methoxy-2-nitrobenzaldehyde; MFCD00007135 |
| Molecular Formula | CH3OC6H3(NO2)CHO |
| Molecular Weight | 181.15 |
| Purity | ≥97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 344.2±27.0 °C at 760 mmHg |
| Melting Point | 97-101 °C (lit.) |
| Appearance | solid |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| EINECS | 258-332-9 |
| HTC | 2913000090 |
| PubChem ID | 24850038 |
| MDL Number | MFCD00007135 |
| SMILES | [H]C(=O)c1cccc(OC)c1[N+]([O-])=O |
| InChI | 1S/C8H7NO4/c1-13-7-4-2-3-6(5-10)8(7)9(11)12/h2-5H,1H3 |
| InChI Key | GDTUACILWWLIJF-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1959385 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/43890_1_53055_05_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Benzyloxy-2-hydroxybenzaldehyde | 52085-14-0 | 2A-9043661 |
| 1,4,5,8-Naphthalenetetracarboxylic acid 1,8-monoanhydride | 52671-72-4 | 2A-9043826 |
| 2,2-Dimethyltetrahydro-2H-pyran-4-carboxylic acid | 52916-16-2 | 2A-9043873 |
| 4'-Methoxybiphenyl-4-carbaldehyde | 52988-34-8 | 2A-9043880 |
| Methyl 2-(bromomethyl)-3-furoate | 53020-08-9 | 2A-9043886 |
| (1R-cis)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid | 53179-78-5 | 2A-9043917 |
| Ethyl 2,3-dihydro-5,6-dimethoxy-1-oxo-1H-indene-2-carboxylate | 53295-44-6 | 2A-9043950 |
| 4-Trifluoromethyldiphenyl sulfide | 53451-90-4 | 2A-9043991 |
| Hexapotassium dihydrogen [hexane-1,6-diylbis[nitrilobis(methylene)]]tetrakisphosphonate | 53473-28-2 | 2A-9043997 |
| 3-[4-(Trifluoromethyl)phenyl]propanoic acid | 53473-36-2 | 2A-9043998 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA