
CAS Number53250-83-2
SynonymsWS1&R CG DVQ; EINECS 406-520-8; 2-Chloro-4-(methylsulfonyl)benzoic acid; 2-Chloro-4-methylsulfonylbenzoic acid; MFCD00216496; 2-Chloro-4-methylsulphonylbenzoic acid
Molecular FormulaC8H7ClO4S
Molecular Weight234.66
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point454.8±45.0 °C at 760 mmHg
Melting Point192-193 °C
AppearanceWhite to light yellow or light pink powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53250-83-2 |
| Catalog No. | 2A-9043941 |
| Chinese Name | 2-氯-4-甲磺酰基苯甲酸 |
| Synonyms | WS1&R CG DVQ; EINECS 406-520-8; 2-Chloro-4-(methylsulfonyl)benzoic acid; 2-Chloro-4-methylsulfonylbenzoic acid; MFCD00216496; 2-Chloro-4-methylsulphonylbenzoic acid |
| Molecular Formula | C8H7ClO4S |
| Molecular Weight | 234.66 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 454.8±45.0 °C at 760 mmHg |
| Melting Point | 192-193 °C |
| Appearance | White to light yellow or light pink powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| PubChem ID | 3157474 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClO4S/c1-14(12,13)5-2-3-6(8(10)11)7(9)4-5/h2-4H,1H3,(H,10,11)/p-1 |
| InChI Key | CTTWSFIIFMWHLQ-UHFFFAOYSA-N |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimyristyl peroxydicarbonate | 53220-22-7 | 2A-9043929 |
| 3-Amino-2-methylphenol | 53222-92-7 | 2A-9043932 |
| 2-Hydroxy-5-(1H-pyrrol-1-yl)benzoic acid | 53242-70-9 | 2A-9043937 |
| 2-((4-Chlorophenyl)acetyl)benzoic acid | 53242-76-5 | 2A-9043938 |
| 4-(4-Chloro-benzyl)-2H-phthalazin-1-one | 53242-88-9 | 2A-9043939 |
| Pinaverium bromide | 53251-94-8 | 2A-9043942 |
| 5-Ethyl-2-hydroxy-3-methylcyclopent-2-en-1-one | 53263-58-4 | 2A-9043943 |
| 3-Bromo-1-adamantanecarboxamide | 53263-89-1 | 2A-9043944 |
| 3,5-Diiodobenzyl alcohol | 53279-79-1 | 2A-9043948 |
| 3-Methyl-4-aminobenzensulfonamide | 53297-70-4 | 2A-9043952 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA