
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53242-76-5 |
| Catalog No. | 2A-9043938 |
| Chinese Name | 2-(4-氯苯乙酰基)苯甲酸 |
| Synonyms | EINECS 258-444-8; MFCD07369702; 2-((4-Chlorophenyl)acetyl)benzoic acid |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.7 |
| Purity | 98.00 |
| Density | 1.332 g/cm3 |
| Boiling Point | 456.8ºC at 760 mmHg |
| Appearance | Off-white crystalline powder |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918300090 |
| PubChem ID | 10233439 |
| SMILES | O=C(O)c1ccccc1C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClO3/c16-11-7-5-10(6-8-11)9-14(17)12-3-1-2-4-13(12)15(18)19/h1-8H,9H2,(H,18,19) |
| InChI Key | BDSINYHJZLINDJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[(1E,3E)-5-(3,3-Dimethyl-1-propyl-1,3-dihydro-2H-indol-2-ylidene)-1,3-pentadienyl]-3,3-dimethyl-1-propyl-3H-indolium iodide | 53213-98-2 | 2A-9043925 |
| Dihydromyrcenol | 53219-21-9 | 2A-9043928 |
| Dimyristyl peroxydicarbonate | 53220-22-7 | 2A-9043929 |
| 3-Amino-2-methylphenol | 53222-92-7 | 2A-9043932 |
| 2-Hydroxy-5-(1H-pyrrol-1-yl)benzoic acid | 53242-70-9 | 2A-9043937 |
| 4-(4-Chloro-benzyl)-2H-phthalazin-1-one | 53242-88-9 | 2A-9043939 |
| 2-Chloro-4-methylsulphonylbenzoic acid | 53250-83-2 | 2A-9043941 |
| Pinaverium bromide | 53251-94-8 | 2A-9043942 |
| 5-Ethyl-2-hydroxy-3-methylcyclopent-2-en-1-one | 53263-58-4 | 2A-9043943 |
| 3-Bromo-1-adamantanecarboxamide | 53263-89-1 | 2A-9043944 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA