
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52807-27-9 |
| Catalog No. | 2A-9043856 |
| Chinese Name | 4-氯-2-碘苯甲醚 |
| Synonyms | MFCD00052858; 4-CHLORO-2-IODOANISOLE; IR CG FO1; 4-Chloro-2-iodo-1-methoxybenzene |
| Molecular Formula | C7H6ClIO |
| Molecular Weight | 268.48 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 271.0±25.0 °C at 760 mmHg |
| Melting Point | 48 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| PubChem ID | 3257414 |
| SMILES | COc1ccc(Cl)cc1I |
| InChI | InChI=1S/C7H6ClIO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| InChI Key | CXXXAGIYCFOGHA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Bromo-2-methylbenzonitrile | 52780-15-1 | 2A-9043850 |
| Platinum(IV) oxide | 52785-06-5 | 2A-9043851 |
| N-(5-Chloro-2-methoxyphenyl)-3-oxobutanamide | 52793-11-0 | 2A-9043852 |
| D-3,4-Dichlorophenylalanine | 52794-98-6 | 2A-9043853 |
| 3-Hydroxy-4-methoxybenzonitrile | 52805-46-6 | 2A-9043855 |
| 2-(2-Methoxyethoxy)ethyl chloride | 52808-36-3 | 2A-9043857 |
| L-Quisqualic acid | 52809-07-1 | 2A-9043858 |
| N-Methyl-N-thiobenzoylhydrazine hydrochloride | 52816-36-1 | 2A-9043860 |
| Bis(2,2,6,6-tetramethyl-4-piperidyl)sebacate | 52829-07-9 | 2A-9043863 |
| 2-Amino-5-bromonicotinic acid | 52833-94-0 | 2A-9043866 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA