
CAS Number1016-78-0
Synonymsm-Chlorobenzophenone; Benzophenone,3-chloro; 3-Chlorobenzophenone; EINECS 213-809-0; MFCD00009816; (3-Chlorophenyl)(phenyl)methanone; 1-(m-Chlorobenzoyl)benzene
Molecular FormulaC13H9O1Cl1
Molecular Weight216.67
Purity97%
Density1.2±0.1 g/cm3
Boiling Point339.1±25.0 °C at 760 mmHg
Melting Point85-87 °C(lit.)
AppearanceWhite crystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1016-78-0 |
| Catalog No. | 2A-9004373 |
| Chinese Name | 3-氯二苯甲酮 |
| Synonyms | m-Chlorobenzophenone; Benzophenone,3-chloro; 3-Chlorobenzophenone; EINECS 213-809-0; MFCD00009816; (3-Chlorophenyl)(phenyl)methanone; 1-(m-Chlorobenzoyl)benzene |
| Molecular Formula | C13H9O1Cl1 |
| Molecular Weight | 216.67 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 339.1±25.0 °C at 760 mmHg |
| Melting Point | 85-87 °C(lit.) |
| Appearance | White crystalline solid |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| HTC | 2914700090 |
| MDL Number | MFCD00009816 |
| SMILES | O=C(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H |
| InChI Key | CPLWKNRPZVNELG-UHFFFAOYSA-N |
| MSDS | msds/4373_1_1016_78_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Chlorobenzophenone Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chlorobenzeneacetonitrile | 1529-41-5 | 2A-9004367 |
| 3-Chlorobenzenecarbothioamide | 2548-79-0 | 2A-9004368 |
| 3-Chlorobenzenesulphonyl chloride | 2888-06-4 | 2A-9004369 |
| 3-Chlorobenzenethiol | 2037-31-2 | 2A-9004370 |
| 3-Chlorobenzonitrile | 766-84-7 | 2A-9004372 |
| 3-Chlorobenzyl alcohol | 873-63-2 | 2A-9004374 |
| 3-Chlorobenzylamine | 4152-90-3 | 2A-9004375 |
| 3-Chlorocinnamic acid | 1866-38-2 | 2A-9004376 |
| 3-Chlorodibenzo[b,e]oxepin-11-one | 2A-104377 | 2A-9004377 |
| 3-Chloroiminodibenzyl | 32943-25-2 | 2A-9004379 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA