
CAS Number2037-31-2
Synonyms3-Chloromercaptobenzene; MFCD00004839; 3-chlorophenylthiol; 3-chlorobenzene-1-thiol; m-Chlorothiophenol; m-Chlorobenzenethiol; Benzenethiol,3-chloro; 3-Chloro thiophenol; Benzenethiol,m-chloro; 3-Chlorothiophenol; EINECS 218-010-0; 3-Chlorobenzenethiol
Molecular FormulaC6H4Cl1Br1S1
Molecular Weight223.52
Purity98%
Density1.3±0.1 g/cm3
Boiling Point206.8±13.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2037-31-2 |
| Catalog No. | 2A-9004370 |
| Chinese Name | 3-氯苯硫酚 |
| Synonyms | 3-Chloromercaptobenzene; MFCD00004839; 3-chlorophenylthiol; 3-chlorobenzene-1-thiol; m-Chlorothiophenol; m-Chlorobenzenethiol; Benzenethiol,3-chloro; 3-Chloro thiophenol; Benzenethiol,m-chloro; 3-Chlorothiophenol; EINECS 218-010-0; 3-Chlorobenzenethiol |
| Molecular Formula | C6H4Cl1Br1S1 |
| Molecular Weight | 223.52 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 206.8±13.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2930909090 |
| MDL Number | MFCD12026137 |
| SMILES | Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H5ClS/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| InChI Key | CQJDYPZUDYXHLM-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/4370_1_2037_31_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-5-fluoroanisole | 202925-08-4 | 2A-9004362 |
| 3'-Chloroacetophenone | 99-02-5 | 2A-9004366 |
| 3-Chlorobenzeneacetonitrile | 1529-41-5 | 2A-9004367 |
| 3-Chlorobenzenecarbothioamide | 2548-79-0 | 2A-9004368 |
| 3-Chlorobenzenesulphonyl chloride | 2888-06-4 | 2A-9004369 |
| 3-Chlorobenzonitrile | 766-84-7 | 2A-9004372 |
| 3-Chlorobenzophenone | 1016-78-0 | 2A-9004373 |
| 3-Chlorobenzyl alcohol | 873-63-2 | 2A-9004374 |
| 3-Chlorobenzylamine | 4152-90-3 | 2A-9004375 |
| 3-Chlorocinnamic acid | 1866-38-2 | 2A-9004376 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA