
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51828-93-4 |
| Catalog No. | 2A-9043599 |
| Chinese Name | alpha-酮基苯丙酸钙盐 |
| Synonyms | Calcium bis(2-oxo-3-phenylpropanoate); Calcium bis(3-phenylpyruvate); 2-KETO-PHENYLALANINE CALCIUM SALT; Benzenepropanoic acid, α-oxo-, calcium salt (2:1); EINECS 257-455-5; MFCD00037200 |
| Molecular Formula | C18H14O6Ca1 |
| Molecular Weight | 366.38 |
| Purity | 98.00 |
| HTC | 2918300090 |
| PubChem ID | 9601640 |
| MDL Number | MFCD00037200 |
| SMILES | O=C([O-])C(=O)Cc1ccccc1.O=C([O-])C(=O)Cc1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C9H8O3.Ca/c2*10-8(9(11)12)6-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,11,12);/q;;+2/p-2 |
| InChI Key | BKMMOJVSLBZNTK-UHFFFAOYSA-L |
| MSDS | msds/43599_1_51828_93_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Octakis(trimethylsiloxy)silsesquioxane | 51777-38-9 | 2A-9043585 |
| Carteolol | 51781-06-7 | 2A-9043588 |
| 2',4',6'-Trifluoroacetophenone | 51788-77-3 | 2A-9043592 |
| Tris(2-carboxyethyl)phosphine hydrochloride | 51805-45-9 | 2A-9043596 |
| Giemsa stain | 51811-82-6 | 2A-9043597 |
| Calcium alpha-ketovaline | 51828-94-5 | 2A-9043600 |
| Ferric phosphate hydrate | 51833-68-2 | 2A-9043603 |
| Aspartyl-argininyl-valinyl-tyrosinyl-isoleucinyl-histidinyl-proline | 51833-78-4 | 2A-9043604 |
| Dihydrogen hexahydroxyplatinate | 51850-20-5 | 2A-9043606 |
| 1H,1H,2H,2H-Perfluorooctyltriethoxysilane | 51851-37-7 | 2A-9043607 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA