
CAS Number51762-05-1
Synonymscgp9000; Oraspor; antibioticcgp9000; cxd; 7-(d-2-amino-2-(1,4-cyclohexadienyl)acetamide)-3-methoxy-3-cephem-4-carboxyl; cefroxadin
Molecular FormulaC16H19N3O5S
Molecular Weight365.40400
Purity98.00%
Density1.5 g/cm3
Boiling Point719.3ºC at 760 mmHg
Melting Point170° (dec)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51762-05-1 |
| Catalog No. | 2A-9043578 |
| Chinese Name | 头孢沙定 |
| Synonyms | cgp9000; Oraspor; antibioticcgp9000; cxd; 7-(d-2-amino-2-(1,4-cyclohexadienyl)acetamide)-3-methoxy-3-cephem-4-carboxyl; cefroxadin |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.40400 |
| Purity | 98.00 |
| Density | 1.5 g/cm3 |
| Boiling Point | 719.3ºC at 760 mmHg |
| Melting Point | 170° (dec) |
| Storage Condition | Warehouse low temperature ventilation and drying |
| Application | Cephalosporin (CGP 9000) is an orally active cephalosporin antibiotic. The MIC values of cefoperadine against Escherichia coli and Klebsiella pneumoniae were 3.13 and 1.56 μg/mL respectively, and th |
| PubChem ID | 583368 |
| SMILES | COC1=C(C(=O)O)N2C(=O)C(NC(=O)C(N)C3=CCC=CC3)C2SC1 |
| InChI | InChI=1S/C16H19N3O5S/c1-24-9-7-25-15-11(14(21)19(15)12(9)16(22)23)18-13(20)10(17)8-5-3-2-4-6-8/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| InChI Key | RDMOROXKXONCAL-UEKVPHQBSA-N |
| Transport Info | Product name: Compound T21461 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-(2-Chlorophenyl)-7-bromo-1,4-benzodiazepin-2-one | 51753-57-2 | 2A-9043572 |
| 3-(Methylthio)-1-hexanol | 51755-66-9 | 2A-9043573 |
| 3-Mercaptohexanol | 51755-83-0 | 2A-9043574 |
| 3-(Methylthio)hexyl acetate | 51755-85-2 | 2A-9043575 |
| Dimethyl 5-bromoisophthalate | 51760-21-5 | 2A-9043576 |
| 3-Phenylsulfanylphthalonitrile | 51762-68-6 | 2A-9043580 |
| 3'-Methylpropiophenone | 51772-30-6 | 2A-9043582 |
| Octakis(trimethylsiloxy)silsesquioxane | 51777-38-9 | 2A-9043585 |
| Carteolol | 51781-06-7 | 2A-9043588 |
| 2',4',6'-Trifluoroacetophenone | 51788-77-3 | 2A-9043592 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA