
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51306-35-5 |
| Catalog No. | 2A-9043444 |
| Chinese Name | 5-(4,6-二氯三嗪)氨基荧光素 |
| Synonyms | 5-dtaf; dtaf 2hcl; dtaf hcl |
| Molecular Formula | C23H13Cl3N4O5 |
| Molecular Weight | 531.73200 |
| Purity | 98.00 |
| Density | 1.81g/cm3 |
| Boiling Point | 834.4ºC at 760mmHg |
| Melting Point | >325ºC |
| Storage Condition | Sealed, store at 2 ºC -8 ºC |
| Application | 5-DTAF is an isomeric fluorescein derivative that reacts directly with polysaccharides and other alcohols in aqueous solutions with pH > 9. After excitation at 488 nm, the maximum wavelength of the 5- |
| PubChem ID | 3190734 |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(Nc3nc(Cl)nc(Cl)n3)cc21 |
| InChI | InChI=1S/C23H12Cl2N4O5/c24-20-27-21(25)29-22(28-20)26-10-1-4-14-13(7-10)19(32)34-23(14)15-5-2-11(30)8-17(15)33-18-9-12(31)3-6-16(18)23/h1-9,30-31H,(H,26,27,28,29) |
| InChI Key | HWQQCFPHXPNXHC-UHFFFAOYSA-N |
| Transport Info | Product name: 5-(4,6-dichlorotriazine)aminofluorescein |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Heptakis(2,6-di-O-methyl)-beta-cyclodextrin | 51166-71-3 | 2A-0202152 |
| 4,4-Dimethyloxazolidine | 51200-87-4 | 2A-9043426 |
| Substituted benzene sulfonamide | 51253-00-0 | 2A-9043432 |
| Amsacrine | 51264-14-3 | 2A-9043436 |
| N-Hydroxycyclopropanecarboxamidine | 51285-13-3 | 2A-9043439 |
| 9-Chloro-1-nonanol | 51308-99-7 | 2A-9043446 |
| 4-(Dicyanomethylene)-2-methyl-6-(4-dimethylaminostyryl)-4H-pyran | 51325-91-8 | 2A-9043452 |
| 4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-ylvinyl)-4H-pyran | 51325-95-2 | 2A-9043453 |
| Methyl 3,5-dibromobenzoate | 51329-15-8 | 2A-9043454 |
| 2-Chloro-1-(3,4-difluoro-phenyl)-ethanone | 51336-95-9 | 2A-9043458 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA