
CAS Number51020-87-2
SynonymsEupomatenoid-8; (-)-Licarin B; 5-{(2R,3R)-7-Methoxy-3-methyl-5-[(1E)-1-propen-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole
Molecular FormulaC20H20O4
Molecular Weight324.38
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point428.5±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51020-87-2 |
| Catalog No. | 2A-9043392 |
| Chinese Name | 利卡灵-B |
| Synonyms | Eupomatenoid-8; (-)-Licarin B; 5-{(2R,3R)-7-Methoxy-3-methyl-5-[(1E)-1-propen-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 428.5±45.0 °C at 760 mmHg |
| Storage Condition | 2-8C |
| Application | Licarin B, which can be derived from the seeds of Myristica fragrans, is an inhibitor of NO production and can improve insulin sensitivity by activating PPARγ and GLUT4 in the IRS-1/PI3K/AKT pathway. |
| PubChem ID | 15494841 |
| MDL Number | MFCD13195533 |
| SMILES | CC=Cc1cc(OC)c2c(c1)C(C)C(c1ccc3c(c1)OCO3)O2 |
| InChI | InChI=1S/C20H20O4/c1-4-5-13-8-15-12(2)19(24-20(15)18(9-13)21-3)14-6-7-16-17(10-14)23-11-22-16/h4-10,12,19H,11H2,1-3H3/b5-4+/t12-,19-/m1/s1 |
| InChI Key | DMMQXURQRMNSBM-YZAYTREXSA-N |
| MSDS | msds/43392_1_51020_87_2.pdf |
| Transport Info | Product Name: Licarin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Vinyl neodecanoate | 51000-52-3 | 2A-9043385 |
| Morpholinosulphur trifluoride | 51010-74-3 | 2A-9043386 |
| Tiapride | 51012-32-9 | 2A-9043388 |
| 4-(Morpholinomethyl)aniline | 51013-67-3 | 2A-9043390 |
| (-)-O-Acetyl-D-mandelic acid | 51019-43-3 | 2A-9043391 |
| Nabilone | 51022-71-0 | 2A-9043394 |
| (3-Chlorophenyl)carbamic chloride | 51028-36-5 | 2A-9043397 |
| Triglycerol monolaurate | 51033-31-9 | 2A-9043398 |
| 4-Bromo-5-nitroveratrole | 51072-66-3 | 2A-9043403 |
| Bis(4-aminocyclohexyl) ether | 51097-78-0 | 2A-9043409 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA