| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51012-32-9 |
| Catalog No. | 2A-9043388 |
| Chinese Name | 泰必利 |
| Synonyms | N-[2-(diethylamino)ethyl]-2-methoxy-5-(methylsulfonyl)benzamide; tiapride; tiapride |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 364.89 |
| Purity | 98.00 |
| Density | 1.15 g/cm3 |
| Boiling Point | 498.1ºC at 760 mmHg |
| Melting Point | 120ºC |
| Storage Condition | 2-8°C |
| Application | Tiapride is an atypical antipsychotic and a selective dopamine D2 receptor antagonist that is rarely prone to catalytic reactions and sedation. For D1, the IC50 values of tiapride are 1440, 45.8, >1 |
| HTC | 2924299090 |
| PubChem ID | 5650056 |
| SMILES | [S](=O)(=O)(C)c1cc(c(cc1)OC)C(=O)NCC[N+H](CC)CC.[Cl-] |
| InChI | 1S/C15H24N2O4S.ClH/c1-5-17(6-2)10-9-16-15(18)13-11-12(22(4,19)20)7-8-14(13)21-3;/h7-8,11H,5-6,9-10H2,1-4H3,(H,16,18);1H |
| InChI Key | OTFDPNXIVHBTKW-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/43388_1_51012_32_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dichloro(cycloocta-1,5-diene)ruthenium(II) | 50982-12-2 | 2A-9043379 |
| Methyl 2,5-Dibromopentanoate | 50995-48-7 | 2A-9043381 |
| N-Acetylneuraminic acid methyl ester | 50998-13-5 | 2A-9043383 |
| Vinyl neodecanoate | 51000-52-3 | 2A-9043385 |
| Morpholinosulphur trifluoride | 51010-74-3 | 2A-9043386 |
| 4-(Morpholinomethyl)aniline | 51013-67-3 | 2A-9043390 |
| (-)-O-Acetyl-D-mandelic acid | 51019-43-3 | 2A-9043391 |
| Licarin B | 51020-87-2 | 2A-9043392 |
| Nabilone | 51022-71-0 | 2A-9043394 |
| (3-Chlorophenyl)carbamic chloride | 51028-36-5 | 2A-9043397 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS