
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50392-39-7 |
| Catalog No. | 2A-9043239 |
| Chinese Name | 4-氨基-2,5-二氯苯酚 |
| Synonyms | 4-Amino-2,5-dichlorophenol; 2,5-Dichloro-4-aminophenol |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 295.8±40.0 °C at 760 mmHg |
| Melting Point | 178-179ºC |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 14748288 |
| SMILES | Nc1cc(Cl)c(O)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-3-2-6(10)4(8)1-5(3)9/h1-2,10H,9H2 |
| InChI Key | RVLKXVCJBJCTCE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromophenacyl bromide | 49851-55-0 | 2A-9043222 |
| Pergascript Red I 6B | 50292-95-0 | 2A-9043228 |
| Bromotris(dimethylamino)phosphonium hexafluorophosphate | 50296-37-2 | 2A-9043230 |
| 4-Vinylbenzylamine | 50325-49-0 | 2A-9043232 |
| 5-Bromoquinoxalin-6-amine | 50358-63-9 | 2A-9043237 |
| 2-[(3-Methylphenyl)sulfonyl]acetic acid ethyl ester | 50397-63-2 | 2A-9043241 |
| 4-Amino-3-bromobenzonitrile | 50397-74-5 | 2A-9043242 |
| 5-(2-Aminoethylamino)-1-naphthalenesulfonic acid | 50402-56-7 | 2A-9043243 |
| 4-Hydroxy-5,6-dimethylpyran-2-one | 50405-45-3 | 2A-9043244 |
| 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone | 50413-24-6 | 2A-9043246 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA