
CAS Number186517-41-9
SynonymsQVR CG BF FXFFF; 5-Chloro-α,α,α,6-tetrafluoro-o-toluic acid; jrd-1021; MFCD01631342; 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoic acid
Molecular FormulaC8H3ClF4O2
Molecular Weight242.555
Purity97%
Density1.6±0.1 g/cm3
Boiling Point263.2±40.0 °C at 760 mmHg
Melting Point96-98°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 186517-41-9 |
| Catalog No. | 2A-9004305 |
| Chinese Name | 3-氯-2-氟-6-(三氟甲基)苯甲酸 |
| Synonyms | QVR CG BF FXFFF; 5-Chloro-α,α,α,6-tetrafluoro-o-toluic acid; jrd-1021; MFCD01631342; 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoic acid |
| Molecular Formula | C8H3ClF4O2 |
| Molecular Weight | 242.555 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 263.2±40.0 °C at 760 mmHg |
| Melting Point | 96-98°C |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C8H3ClF4O2/c9-4-2-1-3(8(11,12)13)5(6(4)10)7(14)15/h1-2H,(H,14,15) |
| InChI Key | PCNHWBAPTNAREE-UHFFFAOYSA-N |
| MSDS | msds/4305_1_186517_41_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Carboxyphenylboronic acid | 25487-66-5 | 2A-9004284 |
| 3-Chloro-2,6-difluorobenzaldehyde | 190011-87-1 | 2A-9004298 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde | 261763-02-4 | 2A-9004302 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride | 261763-03-5 | 2A-9004303 |
| 3-Chloro-2-fluoro-6-(trifluoromethyl)benzaldehyde | 186517-29-3 | 2A-9004304 |
| 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride | 186517-45-3 | 2A-9004306 |
| 3-Chloro-2-fluorobenzaldehyde | 85070-48-0 | 2A-9004308 |
| 3-Chloro-4-(trifluoromethylthio)aniline | 64628-74-6 | 2A-9004325 |
| 3-Chloro-4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}aniline | 76471-06-2 | 2A-9004328 |
| 3-Chloro-4-fluorobenzaldehyde | 34328-61-5 | 2A-9004333 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA