
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 186517-29-3 |
| Catalog No. | 2A-9004304 |
| Chinese Name | 3-氯-2-氟-6-(三氟甲基)苯甲醛 |
| Synonyms | vhr cg bf fxfff; MFCD01631343 |
| Molecular Formula | C8H3ClF4O |
| Molecular Weight | 226.55500 |
| Purity | 98 |
| Density | 1.53 |
| Boiling Point | 214ºC |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2913000090 |
| SMILES | O=Cc1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C11H12ClFO/c1-11(2,3)8-4-5-9(12)10(13)7(8)6-14/h4-6H,1-3H3 |
| InChI Key | WTVMLHFHFBCCBP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Carboxybenzaldehyde | 619-21-6 | 2A-9004283 |
| 3-Carboxyphenylboronic acid | 25487-66-5 | 2A-9004284 |
| 3-Chloro-2,6-difluorobenzaldehyde | 190011-87-1 | 2A-9004298 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde | 261763-02-4 | 2A-9004302 |
| 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride | 261763-03-5 | 2A-9004303 |
| 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoic acid | 186517-41-9 | 2A-9004305 |
| 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride | 186517-45-3 | 2A-9004306 |
| 3-Chloro-2-fluorobenzaldehyde | 85070-48-0 | 2A-9004308 |
| 3-Chloro-4-(trifluoromethylthio)aniline | 64628-74-6 | 2A-9004325 |
| 3-Chloro-4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}aniline | 76471-06-2 | 2A-9004328 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA