
CAS Number39895-56-2
Synonyms[4-(Aminomethyl)phenyl]methanol; (4-(Aminomethyl)phenyl)methanol; 4-hydroxymethylbenzylamine; [4-(aminomethyl)phenyl]methan-1-ol; p-hydroxymethylbenzylamine; 4-Aminomethylbenzyl alcohol; (4-AMINOMETHYL-PHENYL)-METHANOL; 4-(Aminomethyl)-benzenemethanol; 4-(Hydroxymethyl)phenylmethylamine
Molecular FormulaC8H11O1N1
Molecular Weight137.18
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point280.0±20.0 °C at 760 mmHg
Melting Point80-82ºC
Appearanceoff-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39895-56-2 |
| Catalog No. | 2A-9042446 |
| Chinese Name | 4-胺甲基苯甲醇 |
| Synonyms | [4-(Aminomethyl)phenyl]methanol; (4-(Aminomethyl)phenyl)methanol; 4-hydroxymethylbenzylamine; [4-(aminomethyl)phenyl]methan-1-ol; p-hydroxymethylbenzylamine; 4-Aminomethylbenzyl alcohol; (4-AMINOMETHYL-PHENYL)-METHANOL; 4-(Aminomethyl)-benzenemethanol; 4-(Hydroxymethyl)phenylmethylamine |
| Molecular Formula | C8H11O1N1 |
| Molecular Weight | 137.18 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 280.0±20.0 °C at 760 mmHg |
| Melting Point | 80-82ºC |
| Appearance | off-white solid |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| PubChem ID | 10614975 |
| MDL Number | MFCD06213766 |
| SMILES | NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C8H11NO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,10H,5-6,9H2 |
| InChI Key | WMOUKOAUAFESMR-UHFFFAOYSA-N |
| MSDS | msds/42446_1_39895_56_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 3-oxoheptanoate | 39815-78-6 | 2A-9042419 |
| L-Alanine isopropyl ester hydrochloride | 39825-33-7 | 2A-9042422 |
| 1-Amino-3-morpholino-2-propanol | 39849-45-1 | 2A-9042426 |
| 2-Amino-5-bromobenzophenone | 39859-36-4 | 2A-9042430 |
| Hexahydro-1H-azepin-4-ol | 39888-51-2 | 2A-9042436 |
| Quinuclidine hydrochloride | 39896-06-5 | 2A-9042447 |
| 4-Hexyloxyaniline | 39905-57-2 | 2A-9042451 |
| 1-(3-Hydroxyadamantan-1-yl)ethanone | 39917-38-9 | 2A-9042453 |
| 2-(1,1-Dimethylethyl)-4-pyridinamine | 39919-69-2 | 2A-9042454 |
| D-Sulfophenylacetic acid | 39925-38-7 | 2A-9042456 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA