
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39859-36-4 |
| Catalog No. | 2A-9042430 |
| Chinese Name | 2-苯甲酰-4-溴苯胺 |
| Synonyms | (2-Amino-5-bromophenyl)(phenyl)methanone; MFCD00059962; (2-amino-5-bromophenyl)-phenylmethanone; ZR DE BVR |
| Molecular Formula | C13H10O1N1Br1 |
| Molecular Weight | 276.13 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 424.6±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922399090 |
| PubChem ID | 139454 |
| MDL Number | MFCD00059962 |
| SMILES | Nc1ccc(Br)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H10BrNO/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H,15H2 |
| InChI Key | LXJVUGANBDAASB-UHFFFAOYSA-N |
| MSDS | msds/42430_1_39859_36_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Propionamidine hydrochloride | 39800-84-5 | 2A-9042414 |
| 1-Acetyl-5-methyl-2-thioxo-4-imidazolidinone | 39806-38-7 | 2A-9042416 |
| Methyl 3-oxoheptanoate | 39815-78-6 | 2A-9042419 |
| L-Alanine isopropyl ester hydrochloride | 39825-33-7 | 2A-9042422 |
| 1-Amino-3-morpholino-2-propanol | 39849-45-1 | 2A-9042426 |
| Hexahydro-1H-azepin-4-ol | 39888-51-2 | 2A-9042436 |
| 4-(Aminomethyl)benzyl alcohol | 39895-56-2 | 2A-9042446 |
| Quinuclidine hydrochloride | 39896-06-5 | 2A-9042447 |
| 4-Hexyloxyaniline | 39905-57-2 | 2A-9042451 |
| 1-(3-Hydroxyadamantan-1-yl)ethanone | 39917-38-9 | 2A-9042453 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA