CAS Number39684-80-5
Synonyms2-(Boc-amino)ethyl bromide; N-T-Boc-2-Bromethanamine; N-Boc-Bromoethylamine; MFCD02683428; tert-Butyl N-(2-bromoethyl)carbamate; N-(2-Bromoethyl)carbamic Acid tert-Butyl Ester; Carbamic acid, N-(2-bromoethyl)-, 1,1-dimethylethyl ester; 2-(tert-Butoxycarbonylamino)ethyl Bromide; 2-Methyl-2-propanyl (2-bromoethyl)carbamate; tert-Butyl 2-bromoethylcarbamate; tert-Butyl (2-bromoethyl)carbamate
Molecular FormulaBrCH2CH2NHCO2C(CH3)3
Molecular Weight224.10
Purity≥97.0 (GC)%
Density1.3±0.1 g/cm3
Boiling Point262.3±23.0 °C at 760 mmHg
Melting Point30-32 °C (lit.)
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39684-80-5 |
| Catalog No. | 2A-9042387 |
| Chinese Name | 2-(Boc-氨基)乙基溴 |
| Synonyms | 2-(Boc-amino)ethyl bromide; N-T-Boc-2-Bromethanamine; N-Boc-Bromoethylamine; MFCD02683428; tert-Butyl N-(2-bromoethyl)carbamate; N-(2-Bromoethyl)carbamic Acid tert-Butyl Ester; Carbamic acid, N-(2-bromoethyl)-, 1,1-dimethylethyl ester; 2-(tert-Butoxycarbonylamino)ethyl Bromide; 2-Methyl-2-propanyl (2-bromoethyl)carbamate; tert-Butyl 2-bromoethylcarbamate; tert-Butyl (2-bromoethyl)carbamate |
| Molecular Formula | BrCH2CH2NHCO2C(CH3)3 |
| Molecular Weight | 224.10 |
| Purity | ≥97.0 (GC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 262.3±23.0 °C at 760 mmHg |
| Melting Point | 30-32 °C (lit.) |
| Appearance | white solid |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2924199090 |
| PubChem ID | 57647641 |
| MDL Number | MFCD02683428 |
| SMILES | BrCCNC(OC(C)(C)C)=O |
| InChI | 1S/C7H14BrNO2/c1-7(2,3)11-6(10)9-5-4-8/h4-5H2,1-3H3,(H,9,10) |
| InChI Key | TZRQZPMQUXEZMC-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2325117 |
| NACRES Code | NA.22 |
| UNSPSC | 12352101 |
| MSDS | msds/42387_1_39684_80_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Poly[(dimethylimino)(2-hydroxy-1,3-propanedily)chloride] | 39660-17-8 | 2A-9042381 |
| Lithium glycolate | 39663-84-8 | 2A-9042382 |
| L(+)-Lysine monohydrate | 39665-12-8 | 2A-9042383 |
| Ethyl N-[[5-methyl-2-(isopropyl)cyclohexyl]carbonyl]glycinate | 39668-74-1 | 2A-9042384 |
| 2-[2-(2-Ethoxyethoxy)ethoxy]ethyl methacrylate | 39670-09-2 | 2A-9042386 |
| N-(2-Furylmethoxy)phthalimide | 39685-81-9 | 2A-9042388 |
| Methyl isocyanoacetate | 39687-95-1 | 2A-9042389 |
| Bis(vinylsulfonyl)ethane | 39690-70-5 | 2A-9042390 |
| N-Ethyl-p-menthane-3-carboxamide | 39711-79-0 | 2A-9042392 |
| 4-Pentenoyl chloride | 39716-58-0 | 2A-9042393 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS