
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39603-24-2 |
| Catalog No. | 2A-9042367 |
| Chinese Name | 5,7-二甲基靛红 |
| Synonyms | MFCD00047219; 5,7-Dimethylisatin; 5,7-Dimethyl-1H-indole-2,3-dione; 5,7-Dimethylindoline-2,3-dione |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.184 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Melting Point | 245 °C |
| Appearance | Red to red-brown powder |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933990090 |
| PubChem ID | 3153901 |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C10H9NO2/c1-5-3-6(2)8-7(4-5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13) |
| InChI Key | HFZSCCJTJGWTDZ-UHFFFAOYSA-N |
| MSDS | msds/42367_1_39603_24_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Methylpiperazine-1-carbonyl chloride | 39539-66-7 | 2A-9042351 |
| 5-(4-Nitrophenylsulfonyl)thiazole-2-amine | 39565-05-4 | 2A-9042363 |
| 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine | 39577-43-0 | 2A-9042364 |
| Methyl benzofuran-2-acetate | 39581-61-8 | 2A-9042365 |
| 1-(4-Methylphenyl)piperazine | 39593-08-3 | 2A-9042366 |
| 2-Amino-3-chloropyridine | 39620-04-7 | 2A-9042370 |
| N-(2,6-Dimethylphenyl)pyridine-2-carboxamide | 39627-98-0 | 2A-9042371 |
| (1,4'-Bipiperidine)-4'-carboxamide | 39633-82-4 | 2A-9042372 |
| N-(2'-Pyridinecarbonyl)piperazine | 39639-98-0 | 2A-9042374 |
| 3-Phenylbenzo[c]isoxazole-5-carboxylic acid | 39695-71-1 | 2A-9042391 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA