
CAS Number39577-43-0
Synonyms1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine (CCP); 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine; EINECS 254-529-9; MFCD01026118; 1-(3-chloropropyl)-4-(3-chlorophenyl)piperazine
Molecular FormulaC13H18Cl2N2
Molecular Weight273.208
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point395.8±42.0 °C at 760 mmHg
Melting Point199 °C
AppearanceWhite to light yellow crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39577-43-0 |
| Catalog No. | 2A-9042364 |
| Chinese Name | 1-(3-氯苯基)-4-(3-氯丙基)哌嗪 |
| Synonyms | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine (CCP); 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine; EINECS 254-529-9; MFCD01026118; 1-(3-chloropropyl)-4-(3-chlorophenyl)piperazine |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.208 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 395.8±42.0 °C at 760 mmHg |
| Melting Point | 199 °C |
| Appearance | White to light yellow crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2933599090 |
| PubChem ID | 480878 |
| MDL Number | MFCD01026118 |
| SMILES | ClCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2N2/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13/h1,3-4,11H,2,5-10H2 |
| InChI Key | NDQKGEFMUGSRNS-UHFFFAOYSA-N |
| MSDS | msds/42364_1_39577_43_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(2-Bromoethyl)pyridine | 39232-04-7 | 2A-9042294 |
| 5-Methylisoxazole-3-carbonyl chloride | 39499-34-8 | 2A-9042332 |
| Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate | 39514-19-7 | 2A-9042341 |
| 4-Methylpiperazine-1-carbonyl chloride | 39539-66-7 | 2A-9042351 |
| 5-(4-Nitrophenylsulfonyl)thiazole-2-amine | 39565-05-4 | 2A-9042363 |
| Methyl benzofuran-2-acetate | 39581-61-8 | 2A-9042365 |
| 1-(4-Methylphenyl)piperazine | 39593-08-3 | 2A-9042366 |
| 5,7-Dimethyl-1H-indole-2,3-dione | 39603-24-2 | 2A-9042367 |
| 2-Amino-3-chloropyridine | 39620-04-7 | 2A-9042370 |
| N-(2,6-Dimethylphenyl)pyridine-2-carboxamide | 39627-98-0 | 2A-9042371 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA