
CAS Number39520-24-6
SynonymsPropanedioic acid, (2-methylpropyl)-, dimethyl ester; dimethyl 2-(2-methylpropyl)propanedioate; Dimethyl (2-methylpropyl)malonate; Malonic acid, isobutyl-, dimethyl ester; Propanedioic acid, 2-(2-methylpropyl)-, dimethyl ester; Dimethyl isobutylmalonate; MFCD00015640; EINECS 254-490-8
Molecular FormulaC9H16O4
Molecular Weight188.22
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point207.0±8.0 °C at 760 mmHg
AppearanceColorless to light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39520-24-6 |
| Catalog No. | 2A-9042347 |
| Chinese Name | 异丁基丙二酸二甲酯 |
| Synonyms | Propanedioic acid, (2-methylpropyl)-, dimethyl ester; dimethyl 2-(2-methylpropyl)propanedioate; Dimethyl (2-methylpropyl)malonate; Malonic acid, isobutyl-, dimethyl ester; Propanedioic acid, 2-(2-methylpropyl)-, dimethyl ester; Dimethyl isobutylmalonate; MFCD00015640; EINECS 254-490-8 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 207.0±8.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow transparent liquid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2917190090 |
| PubChem ID | 3154471 |
| SMILES | COC(=O)C(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C9H16O4/c1-6(2)5-7(8(10)12-3)9(11)13-4/h6-7H,5H2,1-4H3 |
| InChI Key | GAZFDPSEEIVCEX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3,5-Dimethoxyphenyl)-1-methylethyl phenyl carbonate | 39507-97-6 | 2A-9042335 |
| 5-Bromo-1,3-dihydrobenzoimidazol-2-one | 39513-26-3 | 2A-9042339 |
| Cyphenothrin | 39515-40-7 | 2A-9042342 |
| Tiopropamine | 39516-21-7 | 2A-9042345 |
| Dimethyl butylmalonate | 39520-22-4 | 2A-9042346 |
| 4-tert-Butylbenzoylacetonitrile | 39528-62-6 | 2A-9042349 |
| Isonipecotamide | 39546-32-2 | 2A-9042352 |
| 2-Amino-4,6-dichloro-5-methylphenol hydrochloride | 39549-31-0 | 2A-9042354 |
| 2-Amino-4-methylbenzamide | 39549-79-6 | 2A-9042355 |
| 4-Vinylbenzo-18-crown-6 | 39557-71-6 | 2A-9042358 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA