
CAS Number39515-40-7
Synonyms(±)-α-cyano-3-phenoxybenzyl (±)-cis-trans-chrysanthemate; (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS; Cyphenothrin; Cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate; α-Cyano-m-phenoxybenzyl 2,2-Dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate; 2,2-Dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic Acid Cyano(3-phenoxyphenyl)methyl Ester; UNII:S0IU5Y1R32; α-Cyano-3-phenoxybenzyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; s2703; D-CYPHENOTHRIN; CISCYPHENOTHRIN; sp2703; EINECS 254-484-5; D-TRANS-CYPHENOTHRIN; s2703forte; MFCD01960864; TRANSCYPHENOTHRIN; 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; Cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate; Gokilaht; Cyan(3
Molecular FormulaC24H25NO3
Molecular Weight375.46
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point481.6±45.0 °C at 760 mmHg
Melting Point25ºC
AppearanceLight yellow viscous liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39515-40-7 |
| Catalog No. | 2A-9042342 |
| Chinese Name | 右旋苯醚氰菊酯 |
| Synonyms | (±)-α-cyano-3-phenoxybenzyl (±)-cis-trans-chrysanthemate; (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS; Cyphenothrin; Cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate; α-Cyano-m-phenoxybenzyl 2,2-Dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate; 2,2-Dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic Acid Cyano(3-phenoxyphenyl)methyl Ester; UNII:S0IU5Y1R32; α-Cyano-3-phenoxybenzyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; s2703; D-CYPHENOTHRIN; CISCYPHENOTHRIN; sp2703; EINECS 254-484-5; D-TRANS-CYPHENOTHRIN; s2703forte; MFCD01960864; TRANSCYPHENOTHRIN; 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; Cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate; Gokilaht; Cyan(3 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.46 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 481.6±45.0 °C at 760 mmHg |
| Melting Point | 25ºC |
| Appearance | Light yellow viscous liquid |
| Packaging | III |
| Application | Cyphenothrin (S-2703) is a pyrethroid insecticide. Cyphenothrin acts on the neuromuscular system of insects and interferes with the gating mechanism of sodium channels. |
| PubChem ID | 583351 |
| SMILES | CC(C)=CC1C(C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C24H25NO3/c1-16(2)13-20-22(24(20,3)4)23(26)28-21(15-25)17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-22H,1-4H3 |
| InChI Key | FJDPATXIBIBRIM-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Transport Info | Product Name: Dex-cypermethrin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Metatartaric acid | 39469-81-3 | 2A-9042327 |
| 5-Bromo-2-methylaniline | 39478-78-9 | 2A-9042328 |
| 2-(3,5-Dimethoxyphenyl)propan-2-ol | 39507-96-5 | 2A-9042334 |
| 1-(3,5-Dimethoxyphenyl)-1-methylethyl phenyl carbonate | 39507-97-6 | 2A-9042335 |
| 5-Bromo-1,3-dihydrobenzoimidazol-2-one | 39513-26-3 | 2A-9042339 |
| Tiopropamine | 39516-21-7 | 2A-9042345 |
| Dimethyl butylmalonate | 39520-22-4 | 2A-9042346 |
| Dimethyl isobutylmalonate | 39520-24-6 | 2A-9042347 |
| 4-tert-Butylbenzoylacetonitrile | 39528-62-6 | 2A-9042349 |
| Isonipecotamide | 39546-32-2 | 2A-9042352 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA