
CAS Number39068-88-7
SynonymsPhenol,2,3,4-trimethoxy-6-methyl; 2,3,4-Trimethoxy-6-methylphenol; 2-hydroxy-3,4,5-trimethoxy-toluene; 2,3,4,5,6-PENTAFLUOROPHENYL 4-[2-NITRO-4-(TRIFLUOROMETHYL)PHENOXY]BENZENESULFONATE; MFCD07783663; 2-methyl-4,5,6-trimethoxyphenol; 6-methyl-2,3,4-trimethoxyphenol; 2,3-Dimethoxy-5-methyl-hydrochinon-1-methylether; 1-methyl ether of 2,3-dimethoxy-5-methylhydroquinone
Molecular FormulaC10H14O4
Molecular Weight198.22
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point309.8±37.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39068-88-7 |
| Catalog No. | 2A-9042255 |
| Chinese Name | 2,3,4-三甲氧基-6-甲基苯酚 |
| Synonyms | Phenol,2,3,4-trimethoxy-6-methyl; 2,3,4-Trimethoxy-6-methylphenol; 2-hydroxy-3,4,5-trimethoxy-toluene; 2,3,4,5,6-PENTAFLUOROPHENYL 4-[2-NITRO-4-(TRIFLUOROMETHYL)PHENOXY]BENZENESULFONATE; MFCD07783663; 2-methyl-4,5,6-trimethoxyphenol; 6-methyl-2,3,4-trimethoxyphenol; 2,3-Dimethoxy-5-methyl-hydrochinon-1-methylether; 1-methyl ether of 2,3-dimethoxy-5-methylhydroquinone |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 309.8±37.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry |
| HTC | 2909500000 |
| PubChem ID | 42628479 |
| SMILES | COc1cc(C)c(O)c(OC)c1OC |
| InChI | InChI=1S/C10H14O4/c1-6-5-7(12-2)9(13-3)10(14-4)8(6)11/h5,11H,1-4H3 |
| InChI Key | UGNJWQMNCJYWHG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Oxypaeoniflora | 39011-91-1 | 2A-9042245 |
| Dimethyl nitroterephthalate | 39020-35-4 | 2A-9042247 |
| (Z)-Guggulsterone | 39025-23-5 | 2A-9042249 |
| 5-(2-Aminoethyl)-1H-imidazol-2-amine | 39050-13-0 | 2A-9042251 |
| 3,4-Diethoxyaniline | 39052-12-5 | 2A-9042252 |
| 2-Dimethylamino-2-phenylbutan-1-ol | 39068-94-5 | 2A-9042257 |
| 2,9-Dibromo-1,10-phenanthroline | 39069-02-8 | 2A-9042258 |
| Ethyl 2-chloro-6-methylnicotinate | 39073-14-8 | 2A-9042259 |
| 3,5-Dimethylphenylacetonitrile | 39101-54-7 | 2A-9042264 |
| 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene | 39145-47-6 | 2A-9042269 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA