
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38628-65-8 |
| Catalog No. | 2A-9042176 |
| Chinese Name | 2-羟基-3-丁炔酸 |
| Synonyms | 2-Hydroxy-3-butynoic acid; 2-Hydroxybut-3-ynoic acid |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.073 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 279.7±25.0 °C at 760 mmHg |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | Seal and store at 0 ºC |
| HTC | 2918199090 |
| PubChem ID | 10257255 |
| InChI | InChI=1S/C4H4O3/c1-2-3(5)4(6)7/h1,3,5H,(H,6,7) |
| InChI Key | LWNHDEQKHFRYMD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 2-Hydroxy-3-butynoic acid Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2E)-3-(1,3-Benzodioxol-5-yl)-2-propenoic acid | 38489-76-8 | 2A-9042160 |
| 3-(Perfluoro-n-octyl)propenoxide | 38565-53-6 | 2A-9042167 |
| 2-[5-(1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1,3-pentadien-1-yl]-1,3,3-trimethyl-3H-indolium tetrafluoroborate(1-) | 38575-74-5 | 2A-9042169 |
| 3-(Hydroxymethyl)-1-adamantol | 38584-37-1 | 2A-9042170 |
| 9-Oxo-10(9H)-acridineacetic acid | 38609-97-1 | 2A-9042174 |
| 6-Bronmandrostenedione | 38632-00-7 | 2A-9042177 |
| 3-Ethyl-5-[2-(3-methyloxazolidin-2-ylidene)ethylidene]-2-thioxooxazolidin-4-one | 38632-51-8 | 2A-9042178 |
| 2-Cyano-phenothiazine | 38642-74-9 | 2A-9042181 |
| 2,5-Diethoxy-4-[(4-methylphenyl)thio]-benzenediazonium tetrachlorozincate | 38656-51-8 | 2A-9042184 |
| 1,1'-((4-Methylphenyl)imino)bis-2-propanol | 38668-48-3 | 2A-9042185 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA