
CAS Number38235-71-1
SynonymsMFCD00191447; 3-Hydrazinobenzoic acid; 3-hydrazinylbenzoic acid
Molecular FormulaC7H8O2N2
Molecular Weight152.15
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point387.6±25.0 °C at 760 mmHg
Melting Point191-194°C
AppearanceSolid;Light yellow to Brown powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38235-71-1 |
| Catalog No. | 2A-9042108 |
| Chinese Name | 3-肼基苯甲酸 |
| Synonyms | MFCD00191447; 3-Hydrazinobenzoic acid; 3-hydrazinylbenzoic acid |
| Molecular Formula | C7H8O2N2 |
| Molecular Weight | 152.15 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 387.6±25.0 °C at 760 mmHg |
| Melting Point | 191-194°C |
| Appearance | Solid;Light yellow to Brown powder to crystal |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2928000090 |
| PubChem ID | 3159659 |
| MDL Number | MFCD00191447 |
| SMILES | NNc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H8N2O2/c8-9-6-3-1-2-5(4-6)7(10)11/h1-4,9H,8H2,(H,10,11) |
| InChI Key | VBYDSMBICNUTKN-UHFFFAOYSA-N |
| MSDS | msds/42108_1_38235_71_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Hydrazinobenzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluoronicotinic acid | 38186-88-8 | 2A-9042092 |
| 2-Amino-5-bromophenol | 38191-34-3 | 2A-9042093 |
| Tetraammineplatinum dihydroxide | 38201-97-7 | 2A-9042095 |
| Ethyl O-mesitylsulfonylacetohydroxamate | 38202-27-6 | 2A-9042096 |
| Anhydroicaritin | 38226-86-7 | 2A-9042106 |
| 2-Methoxy-N-methyl-1-ethanamine | 38256-93-8 | 2A-9042111 |
| 1,2,4-Tribromobutane | 38300-67-3 | 2A-9042124 |
| 1,8-Dibromopyrene | 38303-35-4 | 2A-9042125 |
| Potassium 3-methoxy-3-oxopropanoate | 38330-80-2 | 2A-9042131 |
| 3,5-Dimethylthiophenol | 38360-81-5 | 2A-9042134 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA