
CAS Number38226-86-7
Synonyms3,5-Dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-9,10-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one; Anhydroicaritin; Cycloicaritin
Molecular FormulaC21H20O6
Molecular Weight368.39
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point575.3±50.0 °C at 760 mmHg
Melting Point222-223 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38226-86-7 |
| Catalog No. | 2A-9042106 |
| Chinese Name | 脱水淫羊藿素 |
| Synonyms | 3,5-Dihydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-9,10-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one; Anhydroicaritin; Cycloicaritin |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 575.3±50.0 °C at 760 mmHg |
| Melting Point | 222-223 °C |
| Storage Condition | room temperature |
| Application | β-Anhydroiceritin is extracted from Boswellia carterii Birdware and has important biological and pharmacological effects, such as anti-osteoporosis, estrogen modulation and anti-tumor properties. β-An |
| PubChem ID | 85283897 |
| MDL Number | MFCD30573905 |
| SMILES | COc1ccc(-c2oc3c4c(cc(O)c3c(=O)c2O)OC(C)(C)CC4)cc1 |
| InChI | InChI=1S/C21H20O6/c1-21(2)9-8-13-15(27-21)10-14(22)16-17(23)18(24)19(26-20(13)16)11-4-6-12(25-3)7-5-11/h4-7,10,22,24H,8-9H2,1-3H3 |
| InChI Key | PPCHTBBOSVKORE-UHFFFAOYSA-N |
| MSDS | msds/42106_1_38226_86_7.pdf |
| Transport Info | Product Name: β-Anhydroiceritin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethy 4-bromobenzylphosphonate | 38186-51-5 | 2A-9042088 |
| 2-Chloro-5-fluoronicotinic acid | 38186-88-8 | 2A-9042092 |
| 2-Amino-5-bromophenol | 38191-34-3 | 2A-9042093 |
| Tetraammineplatinum dihydroxide | 38201-97-7 | 2A-9042095 |
| Ethyl O-mesitylsulfonylacetohydroxamate | 38202-27-6 | 2A-9042096 |
| 3-Hydrazinobenzoic acid | 38235-71-1 | 2A-9042108 |
| 2-Methoxy-N-methyl-1-ethanamine | 38256-93-8 | 2A-9042111 |
| 1,2,4-Tribromobutane | 38300-67-3 | 2A-9042124 |
| 1,8-Dibromopyrene | 38303-35-4 | 2A-9042125 |
| Potassium 3-methoxy-3-oxopropanoate | 38330-80-2 | 2A-9042131 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA