
CAS Number29640-98-0
Synonyms(5-FLUORO-2-NITRO-PHENYL)-ACETIC ACID; WNR DF B1VQ; MFCD07787601; (5-Fluoro-2-nitrophenyl)acetic acid; 5-Fluor-2-nitrophenylessigsaeure; 5-Fluoro-2-nitrophenylacetic acid; 5-Fluoro-2-nitrobenzeneacetic acid; 2-(5-Fluoro-2-nitrophenyl)acetic acid
Molecular FormulaC8H6FNO4
Molecular Weight199.136
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point343.6±27.0 °C at 760 mmHg
Melting Point154-156ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29640-98-0 |
| Catalog No. | 2A-9040604 |
| Chinese Name | 5-氟-2-硝基苯乙酸 |
| Synonyms | (5-FLUORO-2-NITRO-PHENYL)-ACETIC ACID; WNR DF B1VQ; MFCD07787601; (5-Fluoro-2-nitrophenyl)acetic acid; 5-Fluor-2-nitrophenylessigsaeure; 5-Fluoro-2-nitrophenylacetic acid; 5-Fluoro-2-nitrobenzeneacetic acid; 2-(5-Fluoro-2-nitrophenyl)acetic acid |
| Molecular Formula | C8H6FNO4 |
| Molecular Weight | 199.136 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 343.6±27.0 °C at 760 mmHg |
| Melting Point | 154-156ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2916399090 |
| SMILES | O=C(O)Cc1cc(F)ccc1[N+](=O)[O-] |
| InChI Key | HOWBVGXZCYNPOU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Benzylhydroxylamine hydrochloride | 29601-98-7 | 2A-9040596 |
| 2-Allyl-4-hydroxy-3-methyl-2-cyclopenten-1-one | 29605-88-7 | 2A-9040597 |
| 4-(Piperidylmethyl)aniline | 29608-05-7 | 2A-9040598 |
| Almitrine dimesylate | 29608-49-9 | 2A-9040599 |
| 2-Bromo-4-iodoaniline | 29632-73-3 | 2A-9040601 |
| Chloroformamidine hydrochloride | 29671-92-9 | 2A-9040608 |
| 2-Aminothiazol-4-acetic acid | 29676-71-9 | 2A-9040609 |
| Methyl 5-bromonicotinate | 29681-44-5 | 2A-9040613 |
| Methyl 5-methylnicotinate | 29681-45-6 | 2A-9040614 |
| Burgess reagent | 29684-56-8 | 2A-9040617 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA