
CAS Number29608-49-9
SynonymsS2620 bismethanesulfonate; ALMITRINE DIMESILATE; S 2620 bismethanesulfonate; ALMITRINE BISMESYLATE; Almitrine dimethanesulfonate; Almitrine mesylate; 2,4-bis(allylamino)-6-[4-[bis(p-fluorophenyl)methyl]-1-piperazinyl]-s-triazine dimethanesulfonate; Almitrine dimesylate
Molecular FormulaC28H37F2N7O6S2
Molecular Weight669.763
Purity98.00%
Boiling Point606.2ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29608-49-9 |
| Catalog No. | 2A-9040599 |
| Chinese Name | 甲磺酸阿米三嗪 |
| Synonyms | S2620 bismethanesulfonate; ALMITRINE DIMESILATE; S 2620 bismethanesulfonate; ALMITRINE BISMESYLATE; Almitrine dimethanesulfonate; Almitrine mesylate; 2,4-bis(allylamino)-6-[4-[bis(p-fluorophenyl)methyl]-1-piperazinyl]-s-triazine dimethanesulfonate; Almitrine dimesylate |
| Molecular Formula | C28H37F2N7O6S2 |
| Molecular Weight | 669.763 |
| Purity | 98.00 |
| Boiling Point | 606.2ºC at 760 mmHg |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Application | Almitrine mesylate is a peripheral chemoreceptor agonist that selectively inhibits Ca2+-dependent K+ channels. |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C26H29F2N7.CH4O3S/c1-3-13-29-24-31-25(30-14-4-2)33-26(32-24)35-17-15-34(16-18-35)23(19-5-9-21(27)10-6-19)20-7-11-22(28)12-8-20;1-5(2,3)4/h3-12,23H,1-2,13-18H2,(H2,29,30,31,32,33);1H3,(H,2,3,4) |
| InChI Key | MRDBGMJEPGXQHJ-UHFFFAOYSA-N |
| Transport Info | Product name: Amitrigine mesylate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cedrene epoxide | 29597-36-2 | 2A-9040594 |
| 2,2-Bis[[3-(dodecylthio)-1-oxopropoxy]methyl]propane-1,3-diyl bis[3-(dodecylthio)propionate] | 29598-76-3 | 2A-9040595 |
| N-Benzylhydroxylamine hydrochloride | 29601-98-7 | 2A-9040596 |
| 2-Allyl-4-hydroxy-3-methyl-2-cyclopenten-1-one | 29605-88-7 | 2A-9040597 |
| 4-(Piperidylmethyl)aniline | 29608-05-7 | 2A-9040598 |
| 2-Bromo-4-iodoaniline | 29632-73-3 | 2A-9040601 |
| 5-Fluoro-2-nitrophenylacetic acid | 29640-98-0 | 2A-9040604 |
| Chloroformamidine hydrochloride | 29671-92-9 | 2A-9040608 |
| 2-Aminothiazol-4-acetic acid | 29676-71-9 | 2A-9040609 |
| Methyl 5-bromonicotinate | 29681-44-5 | 2A-9040613 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA