
CAS Number28957-72-4
Synonyms8-BENZYLNORTROPAN-3-ONE; N-Bu nortropinone; EINECS 249-329-3; (1R,5S)-8-Benzyl-8-azabicyclo[3.2.1]octan-3-one; N-BENZYLNORTROPINONE; N-Benzyl-8-azabicyclo[3.2.1]octan-3-one; 8-Benzyl-8-azabicyclo[3.2.1]octan-3-one; 8-Benzyl-8-azabicyclo(3.2.1)octan-3-one; 8-Benzyl-3-nortropanone; N-Benzyl-3-nortropinone; MFCD00151640
Molecular FormulaC14H17NO
Molecular Weight215.291
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point342.9±22.0 °C at 760 mmHg
Melting Point28-29ºC
AppearanceOff-white to light yellow low melting point solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28957-72-4 |
| Catalog No. | 2A-9040491 |
| Chinese Name | N-苄基托品酮 |
| Synonyms | 8-BENZYLNORTROPAN-3-ONE; N-Bu nortropinone; EINECS 249-329-3; (1R,5S)-8-Benzyl-8-azabicyclo[3.2.1]octan-3-one; N-BENZYLNORTROPINONE; N-Benzyl-8-azabicyclo[3.2.1]octan-3-one; 8-Benzyl-8-azabicyclo[3.2.1]octan-3-one; 8-Benzyl-8-azabicyclo(3.2.1)octan-3-one; 8-Benzyl-3-nortropanone; N-Benzyl-3-nortropinone; MFCD00151640 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.291 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 342.9±22.0 °C at 760 mmHg |
| Melting Point | 28-29ºC |
| Appearance | Off-white to light yellow low melting point solid |
| Storage Condition | room temperature |
| HTC | 2933990090 |
| SMILES | O=C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO/c16-14-8-12-6-7-13(9-14)15(12)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChI Key | RSUHKGOVXMXCND-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dibenzyloxyacetophenone | 28924-21-2 | 2A-9040483 |
| 3,5-Dibenzyloxy terbutalline | 28924-25-6 | 2A-9040484 |
| Watermelon Ketone | 28940-11-6 | 2A-9040486 |
| L(+)-allo-Threonine | 28954-12-3 | 2A-9040489 |
| Oridonin | 28957-04-2 | 2A-9040490 |
| Bis(dithiobenzil)nickel(II) | 28984-20-5 | 2A-9040500 |
| 2-Chloro-4-methoxynitrobenzene | 28987-59-9 | 2A-9040501 |
| Methyl 4-methoxybutanoate | 29006-01-7 | 2A-9040503 |
| 5-(2-Nitrophenyl)-2-furoic acid | 29048-34-8 | 2A-9040506 |
| 6-Chloro-4-pyridazinamine | 29049-45-4 | 2A-9040507 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA