
CAS Number28163-00-0
Synonyms2-Chlor-4-nitrobenzonitril; 4-nitro-2-chlorobenzonitrile; 2-Chloro-4-nitrobenzotrifluoride; 2-chloro-4-nitrobenzenecarbonitrile; chloronitrobenzenecarbonitrile; 2-Chloro-4-Nitrobenzonitrile; MFCD00052203; 2-chloro-4-nitro-benzonitrile
Molecular FormulaC7H3ClN2O2
Molecular Weight182.56400
Purity98.00%
Density1.47 g/cm3
Boiling Point337ºC at 760 mmHg
Melting Point83-84 °C
Appearancelight yellow crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28163-00-0 |
| Catalog No. | 2A-9040344 |
| Chinese Name | 2-氯-4-硝基苯腈 |
| Synonyms | 2-Chlor-4-nitrobenzonitril; 4-nitro-2-chlorobenzonitrile; 2-Chloro-4-nitrobenzotrifluoride; 2-chloro-4-nitrobenzenecarbonitrile; chloronitrobenzenecarbonitrile; 2-Chloro-4-Nitrobenzonitrile; MFCD00052203; 2-chloro-4-nitro-benzonitrile |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.56400 |
| Purity | 98.00 |
| Density | 1.47 g/cm3 |
| Boiling Point | 337ºC at 760 mmHg |
| Melting Point | 83-84 °C |
| Appearance | light yellow crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| SMILES | N#Cc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C7H3ClN2O2/c8-7-3-6(10(11)12)2-1-5(7)4-9/h1-3H |
| InChI Key | ZIGQFRQZYVQQDR-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Peucedanol | 28095-18-3 | 2A-9040332 |
| Calcium 2-methoxyethoxide | 28099-67-4 | 2A-9040333 |
| 2-Methoxyimidazoline | 28118-54-9 | 2A-9040335 |
| 1,2-O-(1-Ethoxyethylidene)-beta-D-mannopyranose triacetate | 28140-37-6 | 2A-9040339 |
| Irgarol | 28159-98-0 | 2A-9040342 |
| 2-Amino-6-bromophenol | 28165-50-6 | 2A-9040345 |
| alpha-Cyano-4-hydroxycinnamic acid | 28166-41-8 | 2A-9040346 |
| 3,5-Dinitro-2-methylbenzoic acid | 28169-46-2 | 2A-9040347 |
| 2-Hydroxy-3-nitroacetophenone | 28177-69-7 | 2A-9040349 |
| 5-Aminoisophthalic acid monomethyl ester | 28179-47-7 | 2A-9040352 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA