
CAS Number25168-73-4
Synonyms1-O-Stearoyl-β-D-fructofuranosyl α-D-glucopyranoside; Ryoto sugar ester S 1670; SUCROSE MONOSTEARATE; Saccharose stearate; S-1670; α-D-Glucopyranoside, 1-O-(1-oxooctadecyl)-β-D-fructofuranosyl; Sucrose monostearic acid ester; Sucrapan S
Molecular FormulaC30H56O12
Molecular Weight608.758
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point763.2±60.0 °C at 760 mmHg
Melting Point67-71°C (lit.)
AppearancePowder | White to Off-white
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25168-73-4 |
| Catalog No. | 2A-9039668 |
| Chinese Name | 蔗糖硬脂酸酯 |
| Synonyms | 1-O-Stearoyl-β-D-fructofuranosyl α-D-glucopyranoside; Ryoto sugar ester S 1670; SUCROSE MONOSTEARATE; Saccharose stearate; S-1670; α-D-Glucopyranoside, 1-O-(1-oxooctadecyl)-β-D-fructofuranosyl; Sucrose monostearic acid ester; Sucrapan S |
| Molecular Formula | C30H56O12 |
| Molecular Weight | 608.758 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 763.2±60.0 °C at 760 mmHg |
| Melting Point | 67-71°C (lit.) |
| Appearance | Powder | White to Off-white |
| Water Solubility | Very slightly soluble in water, sparingly soluble |
| Storage Condition | 2-8°C |
| Application | Sucrose stearate can be used as excipients, such as surfactants, emulsifiers, solubilizers, etc. Pharmaceutical excipients or pharmaceutical auxiliaries refer to other chemical substances used in the |
| SMILES | CCCCCCCCCCCCCCCCCC(O)=O.OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C18H36O2.C12H22O11/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h2-17H2,1H3,(H,19,20);4-11,13-20H,1-3H2 |
| InChI Key | InChIKey=ONAIRGOTKJCYEY-UHFFFAOYSA-N |
| Transport Info | Product name: Sucrose stearate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2,6-Dichlorophenoxy)propanoic acid | 25140-90-3 | 2A-9039656 |
| 3-Ethyl-1-methyl-1,3-cyclopentadiene | 25148-01-0 | 2A-9039657 |
| cis-3-Hexenyl benzoate | 25152-85-6 | 2A-9039661 |
| Nonylphenol | 25154-52-3 | 2A-9039662 |
| Bis(tert-butyldioxyisopropyl)benzene | 25155-25-3 | 2A-9039664 |
| 3,3'-Diiodobenzophenone | 25186-99-6 | 2A-9039671 |
| 3-Methoxy-2-piperidone | 25219-59-4 | 2A-9039678 |
| 2-Cyano-3-morpholinoacrylamide | 25229-97-4 | 2A-9039679 |
| N-(3-Nitrophenyl)-3-oxobutanamide | 25233-49-2 | 2A-9039680 |
| 2,2,2-Trifluoroethyl methanesulfonate | 25236-64-0 | 2A-9039682 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA