
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25140-90-3 |
| Catalog No. | 2A-9039656 |
| Chinese Name | 2-(2,6-二氯苯氧基)丙酸 |
| Synonyms | 2-(2,6-Dichlorophenoxy)propanoic acid |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.064 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 345.7±27.0 °C at 760 mmHg |
| HTC | 2918990090 |
| SMILES | CC(Oc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-6(10)3-2-4-7(8)11/h2-5H,1H3,(H,12,13) |
| InChI Key | JTSKVVDMNKQPAO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Cyano-4-phenylcyclohexanone | 25115-74-6 | 2A-9039641 |
| Clobetasone butyrate | 25122-57-0 | 2A-9039645 |
| Tetradecaamminedi-mu-oxotriruthenium(6+) hexachloride | 25125-46-6 | 2A-9039646 |
| Polyquaternium-39 | 25136-75-8 | 2A-9039652 |
| 2-(2-Chlorophenoxy)propionic acid | 25140-86-7 | 2A-9039655 |
| 3-Ethyl-1-methyl-1,3-cyclopentadiene | 25148-01-0 | 2A-9039657 |
| cis-3-Hexenyl benzoate | 25152-85-6 | 2A-9039661 |
| Nonylphenol | 25154-52-3 | 2A-9039662 |
| Bis(tert-butyldioxyisopropyl)benzene | 25155-25-3 | 2A-9039664 |
| Sucrose stearate | 25168-73-4 | 2A-9039668 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA