
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24623-25-4 |
| Catalog No. | 2A-9039532 |
| Chinese Name | 4-硝基-1-茚酮 |
| Synonyms | 4-nitro-2,3-dihydroinden-1-one; 4-Nitroindan-1-one |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.15700 |
| Purity | 98.00 |
| Density | 1.396 g/cm3 |
| Boiling Point | 332.9ºC at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| EINECS | 246-367-2 |
| HTC | 2914700090 |
| SMILES | O=C1CCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C9H7NO3/c11-9-5-4-6-7(9)2-1-3-8(6)10(12)13/h1-3H,4-5H2 |
| InChI Key | QIIWEVWPOBNGLP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-1,2-benzisoxazol-3(2H)-one | 24603-63-2 | 2A-9039524 |
| Sodium 2-amino-1,4-benzenedisulfonate | 24605-36-5 | 2A-9039525 |
| 1-(3',4'-Methylenedioxyphenyl)-2-pyrrolidino-1-pentanone hydrochloride | 24622-62-6 | 2A-9039529 |
| 6-Methyl-1-indanone | 24623-20-9 | 2A-9039530 |
| 6-Nitroindanone | 24623-24-3 | 2A-9039531 |
| L-(+)-Isoleucinol | 24629-25-2 | 2A-9039534 |
| Dimethyl hydroxymethylphosphonate | 24630-67-9 | 2A-9039535 |
| 4-Methyl-1-indanone | 24644-78-8 | 2A-9039539 |
| 2,2-Dimethoxy-2-phenylacetophenone | 24650-42-8 | 2A-9039541 |
| 4-(2-Benzooxazol-2-ylethenyl)-N,N-dimethylaniline | 24675-13-6 | 2A-9039546 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA