
CAS Number24623-24-3
Synonyms6-Nitro-2,3-dihydro-1H-inden-1-one; 2,3-Dihydro-6-nitro-1-oxo-1H-indene; 4-nitro-indan-1-one; 6-nitro-1-indatone; 6-nitroindan-l-one; 6-Nitro-2,3-dihydro-1H-inden-1-on; MFCD06656903; 6-Nitro-1-indanone; 2,3-Dihydro-6-nitro-1H-inden-1-one; EINECS 246-366-7; 6-nitroindan-1-one; 2,3-diidro-6-nitro-1H-indene-1-one; 6-NITROINDANONE
Molecular FormulaC9H7NO3
Molecular Weight177.157
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point332.0±31.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24623-24-3 |
| Catalog No. | 2A-9039531 |
| Chinese Name | 6-硝基-1-茚满酮 |
| Synonyms | 6-Nitro-2,3-dihydro-1H-inden-1-one; 2,3-Dihydro-6-nitro-1-oxo-1H-indene; 4-nitro-indan-1-one; 6-nitro-1-indatone; 6-nitroindan-l-one; 6-Nitro-2,3-dihydro-1H-inden-1-on; MFCD06656903; 6-Nitro-1-indanone; 2,3-Dihydro-6-nitro-1H-inden-1-one; EINECS 246-366-7; 6-nitroindan-1-one; 2,3-diidro-6-nitro-1H-indene-1-one; 6-NITROINDANONE |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.157 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 332.0±31.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| SMILES | O=C1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H7NO3/c11-9-4-2-6-1-3-7(10(12)13)5-8(6)9/h1,3,5H,2,4H2 |
| InChI Key | MLRACZPAMDFORH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Potassium orotate | 24598-73-0 | 2A-9039521 |
| 5-Chloro-1,2-benzisoxazol-3(2H)-one | 24603-63-2 | 2A-9039524 |
| Sodium 2-amino-1,4-benzenedisulfonate | 24605-36-5 | 2A-9039525 |
| 1-(3',4'-Methylenedioxyphenyl)-2-pyrrolidino-1-pentanone hydrochloride | 24622-62-6 | 2A-9039529 |
| 6-Methyl-1-indanone | 24623-20-9 | 2A-9039530 |
| 4-Nitroindanone | 24623-25-4 | 2A-9039532 |
| L-(+)-Isoleucinol | 24629-25-2 | 2A-9039534 |
| Dimethyl hydroxymethylphosphonate | 24630-67-9 | 2A-9039535 |
| 4-Methyl-1-indanone | 24644-78-8 | 2A-9039539 |
| 2,2-Dimethoxy-2-phenylacetophenone | 24650-42-8 | 2A-9039541 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA