
CAS Number23578-45-2
Synonyms2-Methacrylamidoacetic acid; N-methacryloyl-glycine; MFCD00466786; N-methylacryloylglycine; N-Methacryloylglycine; methacryloylglycine; N-methacryloylaminoacetic acid
Molecular FormulaC6H9O3N1
Molecular Weight143.14
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point391.2±34.0 °C at 760 mmHg
Appearancewhite crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23578-45-2 |
| Catalog No. | 2A-9039283 |
| Chinese Name | N-甲基丙烯酰基甘氨酸 |
| Synonyms | 2-Methacrylamidoacetic acid; N-methacryloyl-glycine; MFCD00466786; N-methylacryloylglycine; N-Methacryloylglycine; methacryloylglycine; N-methacryloylaminoacetic acid |
| Molecular Formula | C6H9O3N1 |
| Molecular Weight | 143.14 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 391.2±34.0 °C at 760 mmHg |
| Appearance | white crystal |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2924199090 |
| MDL Number | MFCD00466786 |
| SMILES | C=C(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H9NO3/c1-4(2)6(10)7-3-5(8)9/h1,3H2,2H3,(H,7,10)(H,8,9) |
| InChI Key | BOURDYMMTZXVRY-UHFFFAOYSA-N |
| MSDS | msds/39283_1_23578_45_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(2-Bromoethyl)-1,3-propanediamine dihydrobromide | 23545-42-8 | 2A-9039276 |
| 4-Methylthio-4-methyl-2-pentanone | 23550-40-5 | 2A-9039277 |
| 4,4'-(1,4-Anthraquinonylenediimino)bis[N-cyclohexyl-2-mesitylenesulfonamide] | 23552-74-1 | 2A-9039278 |
| N-(2-Hydroxyethyl)-1,4-butanediamine | 23563-86-2 | 2A-9039279 |
| L-Phenylalanylglycylglycine | 23576-42-3 | 2A-9039281 |
| Hexyl nicotinoate | 23597-82-2 | 2A-9039287 |
| Hexaethyleneglycol monomethyl ether | 23601-40-3 | 2A-9039289 |
| Hexamethylenebis(nitrilodimethylene)tetraphosphonic acid | 23605-74-5 | 2A-9039291 |
| Tris(8-hydroxyquinolinato)erbium | 23606-16-8 | 2A-9039292 |
| 6a,9-Difluoro-11b,17,21-trihydroxypregna-1,4-diene-3,20-dione 17-butyrate | 23640-96-2 | 2A-9039302 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA