
CAS Number22348-96-5
Synonyms3-Oxo-decanoic Acid Methyl Ester; EINECS 244-928-6; Decanoic acid,3-oxo-,methyl ester; Methyl3-oxodecanoate; 3-Oxo-decansaeure-methylester
Molecular FormulaC11H20O3
Molecular Weight200.28
Purity98.00%
Density0.95 g/cm3
Boiling Point245.8ºC at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22348-96-5 |
| Catalog No. | 2A-9038965 |
| Chinese Name | 3-氧代癸酸甲酯 |
| Synonyms | 3-Oxo-decanoic Acid Methyl Ester; EINECS 244-928-6; Decanoic acid,3-oxo-,methyl ester; Methyl3-oxodecanoate; 3-Oxo-decansaeure-methylester |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 |
| Purity | 98.00 |
| Density | 0.95 g/cm3 |
| Boiling Point | 245.8ºC at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2918300090 |
| MDL Number | MFCD00086084 |
| SMILES | CCCCCCCC(=O)CC(=O)OC |
| InChI | InChI=1S/C11H20O3/c1-3-4-5-6-7-8-10(12)9-11(13)14-2/h3-9H2,1-2H3 |
| InChI Key | QOQWSGSXXQSUOD-UHFFFAOYSA-N |
| MSDS | msds/38965_1_22348_96_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (+/-)-Cryptostyline III | 22324-83-0 | 2A-9038954 |
| 5-Sulfoisophthalic acid | 22326-31-4 | 2A-9038956 |
| Dibenzoyltartaric acid | 22333-70-6 | 2A-9038959 |
| Polygalacic acid | 22338-71-2 | 2A-9038960 |
| 4-Hydroxy-7-methylamino-2-naphthalenesulfonic acid | 22346-43-6 | 2A-9038962 |
| 3',5'-Dibromo-2'-hydroxyacetophenone | 22362-66-9 | 2A-9038972 |
| 2-Methylbenzyl cyanide | 22364-68-7 | 2A-9038973 |
| Eupatilin | 22368-21-4 | 2A-9038975 |
| D-Arabinonic acid calcium salt (2:1) | 22373-09-7 | 2A-9038976 |
| 3,5-Di-tert-butylbromobenzene | 22385-77-9 | 2A-9038982 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA