
CAS Number22027-96-9
Synonyms3,4-Dimethoxy-5-nitro-benazldehyde; 3,4-Dimethoxy-5-nitrobenzaldehyde; 3,4-Dimethoxy-5-nitro-benzaldehyd; 5-nitroveratraldehyde; 3-nitro-4,5-dimethoxybenzaldehyde; 3,4-dimethoxy-5-nitro-benzaldehyde; 5-nitroveratral
Molecular FormulaC9H10N2O5
Molecular Weight226.19
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point372.2±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22027-96-9 |
| Catalog No. | 2A-9038855 |
| Chinese Name | 3,4-二甲氧基-5-硝基苯甲醛 |
| Synonyms | 3,4-Dimethoxy-5-nitro-benazldehyde; 3,4-Dimethoxy-5-nitrobenzaldehyde; 3,4-Dimethoxy-5-nitro-benzaldehyd; 5-nitroveratraldehyde; 3-nitro-4,5-dimethoxybenzaldehyde; 3,4-dimethoxy-5-nitro-benzaldehyde; 5-nitroveratral |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 372.2±42.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2913000090 |
| MDL Number | MFCD03931972 |
| SMILES | COc1cc(C=O)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C9H9NO5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3 |
| InChI Key | NOUWQZZKSKEHCI-UHFFFAOYSA-N |
| MSDS | msds/38855_1_22027_96_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| N-Ethyl-N-ethoxylethyl-4-amino benzaldehyde | 21635-78-9 | 2A-9038726 |
| N-Hydroxy-5-norbornene-2,3-dicarboximide | 21715-90-2 | 2A-9038762 |
| 3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester | 21736-07-2 | 2A-9038768 |
| 3-Bromoadamantane-1-carboxylic acid | 21816-08-0 | 2A-9038785 |
| 2,4,6-Tris(bromomethyl)mesitylene | 21988-87-4 | 2A-9038848 |
| Olesoxime | 22033-87-0 | 2A-9038857 |
| 4-(2-Hydroxyethoxy)benzaldehyde | 22042-73-5 | 2A-9038866 |
| 1-Aminocyclopropanecarboxylic acid | 22059-21-8 | 2A-9038869 |
| 4-Hydroxy-2,6-dimethoxybenzaldehyde | 22080-96-2 | 2A-9038877 |
| Chloromethyl chloroformate | 22128-62-7 | 2A-9038891 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA