
CAS Number21736-07-2
Synonyms3-Hydroxy-cyclopentane-1,1-dicarboxylic acid diethyl ester; 1,1-Cyclopentanedicarboxylicacid,3-hydroxy-,1,1-diethyl ester; 3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester
Molecular FormulaC11H18O5
Molecular Weight455.54
Purity≥98 (HPLC)%
Density1.196
Boiling Point292ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21736-07-2 |
| Catalog No. | 2A-9038768 |
| Chinese Name | 3-羟基环戊烷-1,1-二羧酸二乙酯 |
| Synonyms | 3-Hydroxy-cyclopentane-1,1-dicarboxylic acid diethyl ester; 1,1-Cyclopentanedicarboxylicacid,3-hydroxy-,1,1-diethyl ester; 3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 455.54 |
| Purity | ≥98 (HPLC) |
| Density | 1.196 |
| Boiling Point | 292ºC |
| Appearance | powder |
| HTC | 2918199090 |
| SMILES | N1C(=C(C(C(=C1C)C(=O)OCC)c2c(cccc2)\C=C\C(=O)OC(C)(C)C)C(=O)OCC)C |
| InChI | 1S/C26H33NO6/c1-8-31-24(29)21-16(3)27-17(4)22(25(30)32-9-2)23(21)19-13-11-10-12-18(19)14-15-20(28)33-26(5,6)7/h10-15,23,27H,8-9H2,1-7H3/b15-14+ |
| InChI Key | GKQPCPXONLDCMU-CCEZHUSRSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352106 |
| MSDS | msds/38768_1_21736_07_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-Chloromethylmorphanthridine | 21535-44-4 | 2A-9038696 |
| Bis(2,3-epoxypropyl) cyclohex-4-ene-1,2-dicarboxylate | 21544-03-6 | 2A-9038702 |
| 3-Cyclopentene-1-carboxylic acid ethyl ester | 21622-01-5 | 2A-9038723 |
| N-Ethyl-N-ethoxylethyl-4-amino benzaldehyde | 21635-78-9 | 2A-9038726 |
| N-Hydroxy-5-norbornene-2,3-dicarboximide | 21715-90-2 | 2A-9038762 |
| 3-Bromoadamantane-1-carboxylic acid | 21816-08-0 | 2A-9038785 |
| 2,4,6-Tris(bromomethyl)mesitylene | 21988-87-4 | 2A-9038848 |
| 3,4-Dimethoxy-5-nitrobenzaldehyde | 22027-96-9 | 2A-9038855 |
| Olesoxime | 22033-87-0 | 2A-9038857 |
| 4-(2-Hydroxyethoxy)benzaldehyde | 22042-73-5 | 2A-9038866 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA