
CAS Number6967-51-7
Synonyms3,4-methoxybenzylamine hydrochloride; 3,4-Dimethoxybenzylamine hydrochloride; Benzenemethanamine, 3,4-dimethoxy-, hydrochloride (1:1); 1-(3,4-Dimethoxyphenyl)methanamine hydrochloride (1:1); (3,4-dimethoxyphenyl)methanamine hydrochloride; Veratrylamin,Hydrochlorid; veratrylamine,hydrochloride
Molecular FormulaC9H14ClNO2
Molecular Weight203.666
Purity98%
Density1.062 g/cm3
Boiling Point291.1ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6967-51-7 |
| Catalog No. | 2A-9003800 |
| Chinese Name | 3,4-二甲氧基苯甲酰胺盐酸盐 |
| Synonyms | 3,4-methoxybenzylamine hydrochloride; 3,4-Dimethoxybenzylamine hydrochloride; Benzenemethanamine, 3,4-dimethoxy-, hydrochloride (1:1); 1-(3,4-Dimethoxyphenyl)methanamine hydrochloride (1:1); (3,4-dimethoxyphenyl)methanamine hydrochloride; Veratrylamin,Hydrochlorid; veratrylamine,hydrochloride |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.666 |
| Purity | 98 |
| Density | 1.062 g/cm3 |
| Boiling Point | 291.1ºC at 760 mmHg |
| HTC | 2922299090 |
| SMILES | COc1ccc(CN)cc1OC.Cl |
| InChI | InChI=1S/C9H13NO2.Cl/c1-11-8-4-3-7(6-10)5-9(8)12-2;/h3-5H,6,10H2,1-2H3; |
| InChI Key | YMKCMLPZLUTFMS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Dimethoxy-2-(1-methylethyl)benzeneacetonitrile | 2A-103794 | 2A-9003794 |
| 3,4-Dimethoxy-5-hydroxybenzoic acid methyl ester | 83011-43-2 | 2A-9003796 |
| 3,4-Dimethoxy-6-nitrobenzoic acid | 4998-07-6 | 2A-9003797 |
| 3,4-Dimethoxybenzyl alcohol | 93-03-8 | 2A-9003798 |
| 3,4-Dimethoxybenzylamine | 5763-61-1 | 2A-9003799 |
| 3,4-Dimethoxycinnamic acid | 2316-26-9 | 2A-9003801 |
| 3,4-Dimethoxyphenol | 2033-89-8 | 2A-9003802 |
| 3,4-Dimethoxythiophenol | 700-96-9 | 2A-9003805 |
| 3,4-Dimethylbenzenethiol | 18800-53-8 | 2A-9003807 |
| 3,4-Dimethylbenzophenone | 2571-39-3 | 2A-9003808 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA