
CAS Number18931-60-7
Synonyms1-(4-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione; 1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione; MFCD00511276
Molecular FormulaC10H6O2Cl1F3
Molecular Weight250.6
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point292.4±35.0 °C at 760 mmHg
Melting Point60-61°C
AppearanceYellow crystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18931-60-7 |
| Catalog No. | 2A-9037968 |
| Chinese Name | 1-(4-氯苯基)-4,4,4-三氟-1,3-丁二酮 |
| Synonyms | 1-(4-chlorophenyl)-4,4,4-trifluorobutane-1,3-dione; 1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione; MFCD00511276 |
| Molecular Formula | C10H6O2Cl1F3 |
| Molecular Weight | 250.6 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 292.4±35.0 °C at 760 mmHg |
| Melting Point | 60-61°C |
| Appearance | Yellow crystalline solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Closed, cool, dry place |
| HTC | 2914700090 |
| PubChem ID | 3209215 |
| MDL Number | MFCD03420695 |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H6ClF3O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-5,15H/b8-5- |
| InChI Key | LJHFYVKVIIMXQM-UHFFFAOYSA-N |
| MSDS | msds/37968_1_18931_60_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Salmefamol | 18910-65-1 | 2A-9037962 |
| Magnesium salicylate | 18917-89-0 | 2A-9037964 |
| Magnesium L-lactate trihydrate | 18917-93-6 | 2A-9037965 |
| Methyl 2-(3-methoxyphenyl)acetate | 18927-05-4 | 2A-9037966 |
| Diethyl cyclopentylmalonate | 18928-91-1 | 2A-9037967 |
| 3,3'-((3-Methylphenyl)imino)bispropanenitrile | 18934-20-8 | 2A-9037969 |
| Phenothiazine-10-carbonyl chloride | 18956-87-1 | 2A-9037975 |
| (4-Carboxybenzyl)methylbicarbamic acid dibenzyl ester | 18969-60-3 | 2A-9037978 |
| 4,4'-Diisopropylbiphenyl | 18970-30-4 | 2A-9037979 |
| 8-Aminoquinaldine | 18978-78-4 | 2A-9037981 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA