CAS Number18927-05-4
SynonymsMethyl 3-methoxyphenylacetate; Benzeneacetic acid, 3-methoxy-, methyl ester; 3-Methoxyphenylacetic Acid Methyl Ester; Acetic acid, (m-methoxyphenyl)-, methyl ester; Methyl 2-(3-methoxyphenyl)acetate; MFCD00017205; Methyl (3-methoxyphenyl)acetate; Benzeneacetic acid,3-methoxy-,methyl ester
Molecular FormulaC10H12O3
Molecular Weight180.201
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point254.0±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18927-05-4 |
| Catalog No. | 2A-9037966 |
| Chinese Name | 3-甲氧基苯乙酸甲酯 |
| Synonyms | Methyl 3-methoxyphenylacetate; Benzeneacetic acid, 3-methoxy-, methyl ester; 3-Methoxyphenylacetic Acid Methyl Ester; Acetic acid, (m-methoxyphenyl)-, methyl ester; Methyl 2-(3-methoxyphenyl)acetate; MFCD00017205; Methyl (3-methoxyphenyl)acetate; Benzeneacetic acid,3-methoxy-,methyl ester |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.201 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 254.0±15.0 °C at 760 mmHg |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2918990090 |
| PubChem ID | 3210704 |
| SMILES | COC(=O)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
| InChI Key | BSVIOYCZTJRBDB-UHFFFAOYSA-N |
| MSDS | msds/37966_1_18927_05_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium 3-[[(dimethylamino)thioxomethyl]thio]propanesulphonate | 18880-36-9 | 2A-9037956 |
| 2-Ethylhexyl bromide | 18908-66-2 | 2A-9037961 |
| Salmefamol | 18910-65-1 | 2A-9037962 |
| Magnesium salicylate | 18917-89-0 | 2A-9037964 |
| Magnesium L-lactate trihydrate | 18917-93-6 | 2A-9037965 |
| Diethyl cyclopentylmalonate | 18928-91-1 | 2A-9037967 |
| 1-(4-Chlorophenyl)-4,4,4-trifluorobutane-1,3-dione | 18931-60-7 | 2A-9037968 |
| 3,3'-((3-Methylphenyl)imino)bispropanenitrile | 18934-20-8 | 2A-9037969 |
| Phenothiazine-10-carbonyl chloride | 18956-87-1 | 2A-9037975 |
| (4-Carboxybenzyl)methylbicarbamic acid dibenzyl ester | 18969-60-3 | 2A-9037978 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS