
CAS Number17380-77-7
Synonyms1-Phenylcyclobutylamine; 1-Phenylcyclobutylamin; 1-Pcba; 1-Phenylcyclobutanamine hydrochloride (1:1); 1-phenylcyclobutanamine; Cyclobutanamine, 1-phenyl-, hydrochloride (1:1); Cyclobutanamine,1-phenyl; 1-phenyl cyclobutylamine
Molecular FormulaC10H13N1
Molecular Weight147.22
Purity98.00%
Density1.042
Boiling Point232.7ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17380-77-7 |
| Catalog No. | 2A-9037473 |
| Chinese Name | 1-苯基环丁胺 |
| Synonyms | 1-Phenylcyclobutylamine; 1-Phenylcyclobutylamin; 1-Pcba; 1-Phenylcyclobutanamine hydrochloride (1:1); 1-phenylcyclobutanamine; Cyclobutanamine, 1-phenyl-, hydrochloride (1:1); Cyclobutanamine,1-phenyl; 1-phenyl cyclobutylamine |
| Molecular Formula | C10H13N1 |
| Molecular Weight | 147.22 |
| Purity | 98.00 |
| Density | 1.042 |
| Boiling Point | 232.7ºC at 760 mmHg |
| Storage Condition | 2-8°C, store away from light, dry and sealed |
| HTC | 2921499090 |
| PubChem ID | 10251445 |
| MDL Number | MFCD08444192 |
| SMILES | NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C10H13N/c11-10(7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2 |
| InChI Key | OZJAIRCFCMQFIF-UHFFFAOYSA-N |
| MSDS | msds/37473_1_17380_77_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Hydroxyphenyl)propanenitrile | 17362-17-3 | 2A-9037464 |
| Palmitoyl Lyso-phosphocholine | 17364-16-8 | 2A-9037466 |
| Eosin | 17372-87-1 | 2A-9037469 |
| Ferrous sulfate monohydrate | 17375-41-6 | 2A-9037470 |
| 1-Phenylcyclopentylamine | 17380-74-4 | 2A-9037472 |
| Tetrahydrothiopyran-4-one 1,1-dioxide | 17396-35-9 | 2A-9037476 |
| 3-(2-Pyridyl)-DL-alanine | 17407-44-2 | 2A-9037479 |
| Potassium hyaluronate | 31799-91-4 | 2A-9037482 |
| 5-Nitroanthranilonitrile | 17420-30-3 | 2A-9037485 |
| Amiloride hydrochloride dihydrate | 17440-83-4 | 2A-9037492 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA