
CAS Number17362-17-3
Synonymsβ-(4-Hydroxyphenyl)propionitrile; 3-(4-Hydroxyphenyl)propionitrile; 3-(4-Hydroxyphenyl)propanenitrile; EINECS 241-393-0; MFCD00016492
Molecular FormulaC9H9NO
Molecular Weight147.178
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point344.0±17.0 °C at 760 mmHg
Melting Point56-58°C
AppearanceLight yellow to off-white crystal. Melting point 55-60℃.
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17362-17-3 |
| Catalog No. | 2A-9037464 |
| Chinese Name | 3-(4-羟基苯基)丙腈 |
| Synonyms | β-(4-Hydroxyphenyl)propionitrile; 3-(4-Hydroxyphenyl)propionitrile; 3-(4-Hydroxyphenyl)propanenitrile; EINECS 241-393-0; MFCD00016492 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.178 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 344.0±17.0 °C at 760 mmHg |
| Melting Point | 56-58°C |
| Appearance | Light yellow to off-white crystal. Melting point 55-60℃. |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 438197 |
| MDL Number | MFCD00016492 |
| SMILES | N#CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H9NO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2H2 |
| InChI Key | KDMJGLYRWRHKJS-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/37464_1_17362_17_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl (E)-3-cyclohexyl-2-propenoate | 17343-88-3 | 2A-9037455 |
| 3,4-Dihydroxybenzonitrile | 17345-61-8 | 2A-9037456 |
| 2,2-Dimethylsuccinic anhydride | 17347-61-4 | 2A-9037458 |
| tert-Butyl isopropyl ether | 17348-59-3 | 2A-9037459 |
| 2-Methyl-D-phenylalanine | 17350-84-4 | 2A-9037460 |
| Palmitoyl Lyso-phosphocholine | 17364-16-8 | 2A-9037466 |
| Eosin | 17372-87-1 | 2A-9037469 |
| Ferrous sulfate monohydrate | 17375-41-6 | 2A-9037470 |
| 1-Phenylcyclopentylamine | 17380-74-4 | 2A-9037472 |
| 1-Phenylcyclobutylamine | 17380-77-7 | 2A-9037473 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA