
CAS Number16375-88-5
SynonymsN-(4-(Hydroxymethyl)phenyl)acetamide; N-[4-(hydroxymethyl)phenyl]acetamide; MFCD00016868
Molecular FormulaC9H11NO2
Molecular Weight165.194
Purity98.00%
Density1.211 g/cm3
Boiling Point120-122
Melting Point120-122ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16375-88-5 |
| Catalog No. | 2A-9036873 |
| Chinese Name | 4-乙酰胺苄醇 |
| Synonyms | N-(4-(Hydroxymethyl)phenyl)acetamide; N-[4-(hydroxymethyl)phenyl]acetamide; MFCD00016868 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.194 |
| Purity | 98.00 |
| Density | 1.211 g/cm3 |
| Boiling Point | 120-122 |
| Melting Point | 120-122ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2924299090 |
| PubChem ID | 594022 |
| MDL Number | MFCD00016868 |
| SMILES | CC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C9H11NO2/c1-7(12)10-9-4-2-8(6-11)3-5-9/h2-5,11H,6H2,1H3,(H,10,12) |
| InChI Key | XEYORFKUJZEQCH-UHFFFAOYSA-N |
| MSDS | msds/36873_1_16375_88_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-4-nitrophenol | 16292-90-3 | 2A-9036856 |
| 4-Amino-3-nitro-N,N-dimethylaniline | 16293-12-2 | 2A-9036857 |
| Solvent Orange 63 | 16294-75-0 | 2A-9036858 |
| 2-Phenylpropane-2-thiol | 16325-88-5 | 2A-9036863 |
| 4-Ethoxybenzoyl chloride | 16331-46-7 | 2A-9036865 |
| 2,2-Dimethyl-4-pentenoic acid | 16386-93-9 | 2A-9036875 |
| Methylphosphinic acid ethyl ester | 16391-07-4 | 2A-9036876 |
| L-Pyroglutamamide | 16395-57-6 | 2A-9036877 |
| N-Acetyl-L-prolinamide | 16395-58-7 | 2A-9036878 |
| Sodium glycodeoxycholate | 16409-34-0 | 2A-9036882 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA