
CAS Number16292-90-3
Synonyms1,1'-(1,4-Phenylene)bis[3-(2-chloroethyl)urea]; Phenol,3-amino-4-nitro; 2-Amino-4-hydroxy-1-nitro-benzol; 5-hydroxy-2-nitroaniline; 3-Amino-4-nitro-phenol; 2-amino-4-hydroxy-1-nitrobenzene; 2-Nitro-5-hydroxy-anilin
Molecular FormulaH2NC6H3(NO2)OH
Molecular Weight154.12
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point446.6±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16292-90-3 |
| Catalog No. | 2A-9036856 |
| Chinese Name | 3-氨基-4-硝基苯酚 |
| Synonyms | 1,1'-(1,4-Phenylene)bis[3-(2-chloroethyl)urea]; Phenol,3-amino-4-nitro; 2-Amino-4-hydroxy-1-nitro-benzol; 5-hydroxy-2-nitroaniline; 3-Amino-4-nitro-phenol; 2-amino-4-hydroxy-1-nitrobenzene; 2-Nitro-5-hydroxy-anilin |
| Molecular Formula | H2NC6H3(NO2)OH |
| Molecular Weight | 154.12 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 446.6±45.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 10256487 |
| SMILES | Nc1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H,7H2 |
| InChI Key | WGEZJWMZNGUEHR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Allylformamide | 16250-37-6 | 2A-9036845 |
| Eusynthomycin | 16255-48-4 | 2A-9036846 |
| 3-Chlorophenylglycolic acid | 16273-37-3 | 2A-9036852 |
| Zinc salicylate | 16283-36-6 | 2A-9036854 |
| Bis(4-bromophenyl)amine | 16292-17-4 | 2A-9036855 |
| 4-Amino-3-nitro-N,N-dimethylaniline | 16293-12-2 | 2A-9036857 |
| Solvent Orange 63 | 16294-75-0 | 2A-9036858 |
| 2-Phenylpropane-2-thiol | 16325-88-5 | 2A-9036863 |
| 4-Ethoxybenzoyl chloride | 16331-46-7 | 2A-9036865 |
| 4-Acetamidobenzyl alcohol | 16375-88-5 | 2A-9036873 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA