
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54864-78-7 |
| Catalog No. | 2A-9003646 |
| Chinese Name | 3-(七氟正丙基)-5-苯基吡唑 |
| Synonyms | 3-perfluoropropyl-5-phenyl-1H-pyrazole; MFCD00155844; 3-Heptafluoropropyl-5-phenylpyrazole; PC9426 |
| Molecular Formula | C12H7F7N2 |
| Molecular Weight | 312.18600 |
| Purity | 97 |
| Density | 1.454g/cm3 |
| Boiling Point | 323.2ºC at 760 mmHg |
| Melting Point | 85 °C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2933199090 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1cc(-c2ccccc2)n[nH]1 |
| InChI Key | JZKFJUIBEKMWRF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-(4-Fluorophenyl)-1-isopropyl-1H-indole-2-carbaldehyde | 101125-34-2 | 2A-9003618 |
| 3-(4-Hydroxypiperidine-1-carbonyl)piperidine-1-carbaldehyde | 667462-11-5 | 2A-9003622 |
| 3-(4-Nitrophenyl)pyrazole | 20583-31-7 | 2A-9003627 |
| 3-(Bromoacetyl)pyridine hydrobromide | 17694-68-7 | 2A-9003633 |
| 3-(Furan-2-yl)-6-(trifluoromethyl)thieno[3,2-b]pyridine-2-carboxylic acid | 2A-103644 | 2A-9003644 |
| 3-(Trifluoromethyl)pyridine | 3796-23-4 | 2A-9003680 |
| 3,3-Difluoropyrrolidine hydrochloride | 163457-23-6 | 2A-9003696 |
| 3,3-Dimethyl-1-ethyl-2-methyleneindoline | 2A-103699 | 2A-9003699 |
| 3,4,5-Trichloropyridine | 33216-52-3 | 2A-9003712 |
| 3,4-Diaminopyridine | 54-96-6 | 2A-9003732 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA