
CAS Number14572-92-0
Synonyms3-(4-Aminophenyl)-1-propanol; 3-(4-aminophenyl)propan-1-ol; 4-Amino-benzenepropanol; 4-aminophenpropyl alcohol; Benzenepropanol,4-amino
Molecular FormulaC9H13NO
Molecular Weight151.206
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point311.6±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14572-92-0 |
| Catalog No. | 2A-9036266 |
| Chinese Name | 4-氨基苯丙醇 |
| Synonyms | 3-(4-Aminophenyl)-1-propanol; 3-(4-aminophenyl)propan-1-ol; 4-Amino-benzenepropanol; 4-aminophenpropyl alcohol; Benzenepropanol,4-amino |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.206 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 311.6±17.0 °C at 760 mmHg |
| HTC | 2922199090 |
| PubChem ID | 5491111 |
| SMILES | Nc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C9H13NO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7,10H2 |
| InChI Key | VTHAHSYNSNZPSI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-3-mercaptobenzoic acid | 14543-45-4 | 2A-9036255 |
| 6-Chloro-1-indanone | 14548-38-0 | 2A-9036256 |
| 6-Bromoindanone | 14548-39-1 | 2A-9036257 |
| 6-Iodo-1-indanone | 14548-40-4 | 2A-9036258 |
| 7-Chloro-3,4-dihydro-1H-quinolin-2-one | 14548-50-6 | 2A-9036260 |
| 2,6-Dichlorophenethylamine | 14573-23-0 | 2A-9036267 |
| D-3-Bromocamphor-8-sulfonic acid ammonium salt | 14575-84-9 | 2A-9036268 |
| 1-(2-Chlorophenyl)-3-methyl-2-pyrazolin-5-one | 14580-22-4 | 2A-9036269 |
| 4-Methoxyphenyl 2,3,4,6-Tetra-O-acetyl-beta-D-glucopyanoside | 14581-81-8 | 2A-9036270 |
| Bis(acetonitrile)palladium(II) chloride | 14592-56-4 | 2A-9036273 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA